Klorpromazin: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
||
Baris 1:
{{Infobox drug
| Watchedfields = changed
| verifiedrevid = 443519547
| image = Chlorpromazine.svg
| alt = Skeletal formula of chlorpromazine
| width = 222
| image2 = Chlorpromazine-3D-balls.png
| alt2 = Ball-and-stick model of the chlorpromazine molecule
| width2 =
| caption =
<!-- Clinical data -->
| pronounce =
| tradename = Largactil, Thorazine, Sonazine, dll
| Drugs.com = {{drugs.com|monograph|chlorpromazine}}
| MedlinePlus = a682040
| DailyMedID = Chlorpromazine
| pregnancy_AU = C
| pregnancy_AU_comment = <ref name="Drugs.com pregnancy">{{cite web | title=Chlorpromazine Pregnancy and Breastfeeding Warnings | website=Drugs.com | date=5 February 2020 | url=https://www.drugs.com/pregnancy/chlorpromazine.html | access-date=21 August 2020}}</ref>
| pregnancy_category=
| routes_of_administration = Oral, [[rektal]], [[Penyuntikan intraotot|intramuskular]], [[infus|intravena]]
| class = [[Typical antipsychotic]]
| ATC_prefix = N05
| ATC_suffix = AA01
| ATC_supplemental =
<!-- Legal status -->
| legal_AU = S4
| legal_AU_comment =
| legal_BR = C1
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=31 March 2023 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=3 August 2023 |access-date=16 August 2023 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=4 April 2023}}</ref>
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA_comment =
| legal_DE = <!-- Anlage I, II, III or Unscheduled -->
| legal_DE_comment =
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment =
| legal_UK = POM
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment =
| legal_EU = Rx-only
| legal_EU_comment = <ref>{{cite web|url=https://www.ema.europa.eu/documents/psusa/chlorpromazine-list-nationally-authorised-medicinal-products-psusa/00000715/202005_en.pdf |title=List of nationally authorised medicinal products - Active substance: chlorpromazine : Procedure no.: PSUSA/00000715/202005|website=Ema.europa.eu|access-date=3 March 2022}}</ref>
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
| legal_UN_comment =
| legal_status = Rx-only
<!-- Pharmacokinetic data -->
| bioavailability = 10–80% (Oral, variasi antar individu yang besar)<ref name=TGA>{{cite web|title=Australian Product Information – Largactil (chlorpromazine hydrochloride)|work=[[Therapeutic Goods Administration]] (TGA) |publisher=Sanofi Aventis Pty Ltd|date=28 August 2012|access-date=8 December 2013|url=https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2010-PI-05882-3|format=PDF|url-status=live|archive-url=https://web.archive.org/web/20170330162812/https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2010-PI-05882-3|archive-date=30 March 2017}}</ref>
| protein_bound = 90–99%<ref name = TGA/>
| metabolism = [[Hati]], sebagian besar dimediasi [[Sitokrom P450 2D6|CYP2D6]].<ref name = TGA/>
| metabolites =
| onset =
| elimination_half-life = 30 jam<ref name=AHFS2015/>
| duration_of_action =
| excretion = [[Ginjal]] (43–65% dalam 24 jam)<ref name = TGA/>
<!-- Identifiers -->
| index2_label = as HCl
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 50-53-3
| CAS_supplemental = (basis bebas)<br />{{CAS|69-09-0}} (hidroklorida)
| PubChem = 2726
| IUPHAR_ligand = 83
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00477
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2625
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = U42B7VYA4P
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00270
| KEGG2_Ref = {{keggcite|correct|kegg}}
| KEGG2 = D00789
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 3647
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 71
| NIAID_ChemDB =
| PDB_ligand =
| synonyms =
<!-- Chemical and physical data -->
| IUPAC_name = 3-(2-kloro-10''H''-fenotiazin-10-il)-''N'',''N''-dimetilpropan-1-amina
| C=17 | H=19 | Cl=1 | N=2 | S=1
| SMILES = CN(C)CCCN1c2ccccc2Sc2ccc(Cl)cc21
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3
| StdInChI_comment =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZPEIMTDSQAKGNT-UHFFFAOYSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
'''Klorpromazin''' atau 2-Chloro-10-(3-(dimethylamino)propyl)phenothiazine adalah obat yang termasuk [[antipsikotik]] dan [[Antimuntah|antiemetik]]. Chlorpromazine adalah senyawa phenothiazine, yang mempunyai rumus [[molekul]] C22-H26-N2-O4-S dan [[Massa molekul relatif|berat molekul]] 414.5234.<ref>[https://chem.nlm.nih.gov/chemidplus/name/chlorpromazine chlorpromazine] di database ChemIDplus dari dari [[:en:United States National Library of Medicine|United States National Library of Medicine]] (NLM)</ref>
|