Timbal(II) nitrat: Perbedaan antara revisi

Konten dihapus Konten ditambahkan
kTidak ada ringkasan suntingan
Wiz Qyurei (bicara | kontrib)
Tidak ada ringkasan suntingan
Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan
 
(24 revisi perantara oleh 13 pengguna tidak ditampilkan)
Baris 1:
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 445289092
| ImageFile = Lead(II) nitrate 1.jpg
| ImageFile1 = lead nitrate.png
| ImageFileL2 = Lead(II)-nitrate-unit-cell-3D-balls.png
| ImageFileR2 = Lead(II)-nitrate-xtal-3D-SF.png
| IUPACName = Lead(II) nitrate
| OtherNames = Lead nitrate<br />Plumbous nitrate<br />Lead dinitrate<br />Plumb dulcis
|Section1={{Chembox Identifiers
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI =1S/2NO3.Pb/c2*2-1(3)4;/q2*-1;+2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RLJMLMKIBZAXJO-UHFFFAOYSA-N
| InChI = 1S/2NO3.Pb/c2*2-1(3)4;/q2*-1;+2
| InChIKey1 = RLJMLMKIBZAXJO-UHFFFAOYSA-N
| CASNo = 10099-74-8
| CASNo_Ref = {{cascite|correct|CAS}}
| EINECS =
| UNNumber = 1469
| PubChem = 24924
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 23300
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 37187
| SMILES = [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Pb+2]
| RTECS = OG2100000
}}
|Section2={{Chembox Properties
| Formula = Pb(NO<sub>3</sub>)<sub>2</sub>
| MolarMass = 331,2g/mol
| Appearance = Kristal putih tak berwarna
| Density = 4,53 g/cm<sup>3</sup> (20&nbsp;°C)
| MeltingPt = 270&nbsp;°C
| MeltingPt_notes = decomposes
| Solubility = 37,65 g/100 mL (0 &nbsp;°C) <br> 52 g/100 mL (20&nbsp;°C) <br /> 127 g/100 mL (100&nbsp;°C)
| SolubleOther = tak larut<br />0,04 g/100 mL<br />1,3 g/100 mL
| Solvent = [[asam nitrat]]<br />dalam [[etanol]]<br />dalam [[metanol]]
| RefractIndex = 1,782<ref>{{cite book|last =Patnaik|first=Pradyot|year=2003|title=Handbook of Inorganic Chemical Compounds |publisher=McGraw-Hill|page=475|isbn =0-07-049439-8|url=http://books.google.com/?id=Xqj-TTzkvTEC&pg=PA475}}</ref>
}}
|Section3={{Chembox Structure
| CrystalStruct = [[Sistem kristal kubik|Kubik pusat muka]]
| Coordination = kuboktahedral
}}
|Section7={{Chembox Hazards
| ExternalSDS = [http://www.inchem.org/documents/icsc/icsc/eics1000.htm ICSC 1000], [http://www.mallbaker.com/americas/msds/english/L3130_msds_us_Default.pdf MallBaker MSDS]
 
| EUClass = Repr. Cat. 1/3<br />Beracun ('''T''')<br />Berbahaya ('''Xn''')<br />Berbahaya bagi lingkungan ('''N''')
| RPhrases = {{R61}}, {{R20/22}}, {{R33}}, {{R62}}, {{R50/53}}
| SPhrases = {{S53}}, {{S45}}, {{S60}}, {{S61}}
| NFPA-H = 3
| NFPA-F = 0
| NFPA-R = 1
| NFPA-S = OX
| FlashPt = Tidak terbakar
| PEL =
| LDLo = 500 mg/kg (marmot, oral)<ref name=IDLH>{{IDLH|7439921|Senyawa timbal (sebagai Pb)}}</ref>
}}
|Section8={{Chembox Related
| OtherAnions = [[Timbal(II) sulfat]]<br />[[Timbal(II) klorida]] <br /> [[Timbal(II) bromida]]
| OtherCations = [[Timah(II) nitrat]]
| OtherFunction =
| OtherFunction_label =
| OtherCompoundsOtherCpds = [[Talium(III) nitrat]]<br />[[Bismut(III) nitrat]]
}}
}}
'''Timbal(II) nitrat''' adalah suatu [[senyawa anorganik]] dengan [[rumus kimia]] [[Timbal|Pb]]([[Nitrat|NO<sub>3</sub>]])<sub>2</sub>. Senyawa ini umumnya dijumpai sebagai [[kristal]] tak berwarna atau serbuk putih dan, tidak seperti kebanyakan [[garam (kimia)|garam]] timbal(II) lainnya, [[Kelarutan|larut]] dalam [[air]].
 
Senyawa ini telah dikenal sejak [[Abad Pertengahan]] dengan nama '''plumb dulcis''', produksi timbal(II) nitrat baik dari logam [[timbal]] maupun [[timbal(II) oksida|timbal oksida]] dalam [[asam nitrat]] merupakan produksi skala kecil, untuk digunakan langsung dalam pembuatan [[Senyawa anorganik berdasarkan unsur#Timbal (plumbum)|senyawa timbal]] lainnya. Pada abad ke-19 timbal(II) nitrat mulai diproduksi secara komersial di Eropa dan Amerika Serikat. Menurut catatan sejarah, penggunaan utamanya adalah sebagai bahan baku produksi [[pigmen]] untuk [[cat timbal]], tetapi cat sejenis ini sudah digantikan oleh cat yang lebih aman berbahan dasar [[titanium dioksida]]. Penggunaan industri lainnya mencakup [[stabilisator (kimia)|penstabil]] panas dalam [[nilon]] dan [[poliester]], dan sebagai pelapis kertas [[termografi|fototermografi]]. Sejak tahun 2000an, timaltimbal(II) nitrat mulai digunakan dalan [[sianidasi emas]].
 
Timbal(II) nitrat bersifat [[Toksisitas|toksik]], suatu [[oksidator]], dan digolongkan sebagai ''[[Daftar IARC Golongan 2A karsinogen|berpotensi karsinogenik pada manusia]]'' oleh [[Badan Internasional Penelitian Kanker]] (''International Agency for Research on Cancer''). Akibatnya, timbal(II) nitrat harus ditangani dan disimpan dengan tindakan pencegahan keselamatan yang memadai untuk mencegah terhirup, tertelan, dan terkena kulit. Oleh karena sifat alaminya yang berbahaya, aplikasi terbatas timbal (II) nitrat berada di bawah pengawasan ketat.
Baris 75:
Sejak [[Abad Pertengahan]], timbal(II) nitrat telah diproduksi sebagai bahan baku produksi pigmen berwarna dalam [[cat timbal]], seperti [[krom kuning]] (timbal(II) kromat), [[krom jingga]] (timbal(II) hidroksida kromat) dan [[Senyawa anorganik berdasarkan unsur#Timbal (plumbum)|senyawa timbal]] sejenis. Pigmen-pigmen ini digunakan untuk [[pewarnaan]] dan pencetakan [[Kaliko (tekstil)|kaliko]] dan tekstil lainnya.<ref name="pigments">{{cite book|title = A Text-book of Inorganic Chemistry|publisher = MacMillan|year = 1950|page = &nbsp;838|first = James Riddick|last = Partington}}</ref>
 
Pada tahun 1597, [[Alkimia|alkimiawanalkimia]]wan Jerman [[Andreas Libavius]] adalah yang pertama menjelaskan senyawa ini, dengan merujuk pada nama abad pertengahan ''plumb dulcis'' dan ''calx plumb dulcis'', yang berarti ''timbal manis'', karena rasanya.<ref name="libavius">{{cite book|first = Andreas|last = Libavius|authorlink = Andreas Libavius|title = Alchemia Andreæ Libavii|location = Francofurti|publisher = Iohannes Saurius|year = 1595}}</ref> Meskipun awalnya tidak dipahami selama beberapa abad berikutnya, sifat [[dekrepitasi]] timbal(II) nitrat menjadikannya digunakan dalam korek api dan [[bahan peledak]] khusus seperti [[timbal(II) azida|timbal azida]].<ref name="pyrotechnica">{{cite journal|title = Lead nitrate as an oxidizer in blackpowder|journal = Pyrotechnica |volume = 4 |date = October 1978|pages=16–18|first = J.B.|last = Barkley|publisher = Pyrotechnica Publications|location = [[Post Falls, Idaho]]}}</ref>
 
Proses produksi pernah dan masih mengikuti cara kimia sederhana, melarutkan [[timbal]] dalam ''aqua fortis'' ([[asam nitrat]]), dan secara berkala diambil [[Pengendapan (kimia)|endapannya]]. Namun, produksi tetap skala kecil selama berabad-abad, dan produksi komersial timbal(II) nitrat sebagai bahan baku untuk pembuatan senyawa timbal lainnya tidak dilaporkan sampai 1835.<ref name=britannica1911>{{cite web|url = http://www.1911encyclopedia.org/Lead|title = Lead|publisher = [[Encyclopædia Britannica Eleventh Edition]]|accessdate = 2006-10-11}}</ref><ref name=macgregor>{{cite book|first = John|last = Macgregor|title = Progress of America to year 1846|url = https://archive.org/details/cihm_51791|publisher = Whittaker & Co|location = London|year = 1847|isbn = 0-665-51791-2}}</ref> Pada tahun 1974, [[Amerika Serikat|A.S.]] mengkonsumsi senyawa timbal, tidak termasuk pigmen dan aditif [[bensin]], adalah 642&nbsp;ton.<ref name="greenwood">{{cite book| first = Norman N.|last = Greenwood|author2=Earnshaw, A. |year = 1997|title = Chemistry of the Elements|url = https://archive.org/details/chemistryelement00earn_087|edition = 2nd|pages= [https://archive.org/details/chemistryelement00earn_087/page/n409 388], 456|location = Oxford|publisher = Butterworth-Heinemann|isbn = 0-7506-3365-4}}</ref>
 
== Struktur ==
[[ImageBerkas:LeadNitrateCrystalStructure.png|300px|leftkiri|thumbjmpl|Struktur kristal <nowiki>[111]</nowiki> planar]]
[[Struktur kristal]] timbal(II) nitrat padat telah ditentukan menggunakan [[difraksi neutron]].<ref>{{cite journal|first = W.C.|last = Hamilton|title = A neutron crystallographic study of lead nitrate|journal = [[Acta Crystallographica|Acta Crystallogr.]]|year = 1957|volume = 10|pages = 103–107|doi = 10.1107/S0365110X57000304|issue = 2}}</ref><ref name="nowotny">{{cite journal|title = Structure refinement of lead nitrate|first = H.|last = Nowotny|author2=G. Heger |journal = [[Acta Crystallogr. C]]|year = 1986 |volume = 42|pages = 133–35|doi = 10.1107/S0108270186097032|issue = 2}}</ref> Senyawa [[Kristalisasi|mengkristal]] dalam sistem kubik dengan atom timbal dalam sistem [[Sistem kristal kubik|kubik pusat muka]]. [[Golongan ruang]]nya adalah Pa3<sub>Z=4</sub> (notasi [[kisi Bravais]]), yang masing-masing sisi kubus memiliki panjang 784&nbsp;[[pikometer]].
 
Noktah hitam menggambarkan atom timbal, noktah putih gugus nitrat 27&nbsp;pikometer di atas bidang atom timbal. Pada konfigurasi ini, setiap atom timbal [[Ikatan kimia|terikat dengan duabelas atom oksigen ([[panjang ikatan]]:281&nbsp;pikometer). Semua panjang atom N–O juga sama pada 127&nbsnbsp;pikometer.
 
Ketertarikan peneliti pada struktur kristal timbal(II) nitrat terutama didasarkan pada kemungkinan rotasi internal bebas gugus nitrat dalam kisi kristal pada kenaikan temperatur, tetapi ini hingga saat ini belum terbukti.<ref name="nowotny"/>
Baris 100:
Memungkinkan juga untuk mengekstrak nitrat dari bahan organik seperti [[pupuk]] atau [[urin]]. Ekstraksi nitrat menggunakan metode ini tidak sekuat nitrat berderajat kemurnian industri, tetapi dapat digunakan untuk produksi [[serbuk mesiu]].
 
Hampir semua timbal(II) nitrat yang tersedia secara komersial diproduksi sesuai dengan bahan skala [[laboratorium]].<ref name="adlam">{{cite book|last = Adlam|first = George Henry Joseph|author2=Price, Leslie Slater |title = A [[Higher School Certificate (UK)|Higher School Certificate]] Inorganic Chemistry|location = London|publisher = John Murray|year = 1938}}</ref> Dipasok dalam kemasan kantong 25&nbsp;kg hingga kantong jumbo 1.000&nbps;kg, dan dalam kemasan laboratorium. Hal ini dilakukan baik oleh produsen umum bahan kimia laboratorium maupun produsen timbal dan senyawa timbal. Tidak ada produksi skala besar yang telah dilaporkan.
 
Dalam perlakuan limbah timbal menggunakan asam nitrat, misalnya, dalam pengolahan limbah timbal-[[bismut]] dari pengilangan timbal, larutan tak murni timbal(II) nitrat dibuat sebagai [[produk sampingan]]. Larutan ini dilaporkan untuk digunakan dalam proses [[sianidasi emas]].<ref name="sidech">{{cite web|title = Product catalog; other products|url = http://www.sidech.be/products.html|publisher = Sidech|location = Tilly, Belgium|accessdate = 2008-01-05|archive-date = 2007-07-01|archive-url = https://web.archive.org/web/20070701013928/http://www.sidech.be/products.html|dead-url = yes}}</ref>
<!--
== Reactions ==
Apart from [[lead(II) acetate]], lead(II) nitrate is the only common soluble lead compound. Lead(II) nitrate readily [[solvation|dissolves]] in water to give a clear, colourless solution.<ref name="ferris">{{cite journal|first = L.M.|last = Ferris|title = Lead nitrate—Nitric acid—Water system|journal = Journal of Chemicals and Engineering Date|year = 1959|doi = 10.1021/je60007a002|volume = 5|pages = 242–242|issue = 3}}</ref> As an [[ionic compound|ionic substance]], the dissolution of lead(II) nitrate involves [[dissociation (chemistry)|dissociation]] into its constituent ions.
 
== Reaksi ==
:Pb(NO<sub>3</sub>)<sub>2</sub> (s) → Pb<sup>2+</sup> (aq) + 2 N{{chem|O|3|-}} (aq)
Apart fromSelain [[leadtimbal(II) acetateasetat]], leadtimbal(II) nitratenitrat isadalah thesatu-satunya onlysenyawa commontimbal solubleumum leadyang compounddapat larut. LeadTimbal(II) nitratenitrat readilymudah [[solvationkelarutan|dissolveslarut]] indalam waterair tomenghasilkan givelarutan ajernih clear, colourlesstak solutionberwarna.<ref name="ferris">{{cite journal|first = L.M.|last = Ferris|title = Lead nitrate—Nitric acid—Water system|journal = Journal of Chemicals and Engineering Date|year = 1959|doi = 10.1021/je60007a002|volume = 5|pages = 242–242|issue = 3}}</ref> As anSebagai [[ionicsenyawa compound|ionic substanceion]], thepelarutan dissolution of leadtimbal(II) nitratenitrat involvesmelibatkan [[dissociationdisosiasi (chemistrykimia)|dissociationdisosiasi]] into itsmenjadi constituention-ion ionskonstituennya.
 
<center><math>\text{Pb(NO}_3\text{)}_{2(s)} \longrightarrow \text{Pb}_{(aq)}^{2+} + 2\text{NO}_{(aq)}^{3-}</math></center>
Lead(II) nitrate forms a slightly acidic solution, with a pH of 3.0 to 4.0 for a 20% aqueous solution.<ref>http://www.mallbaker.com/americas/msds/english/L3130_msds_us_Default.pdf</ref>
 
Timbal(II) nitrat membentuk larutan yang sedikit asam, dengan pH antara 3,0 sampai 4,0 untuk larutan 20% dalam air.<ref>http://www.mallbaker.com/americas/msds/english/L3130_msds_us_Default.pdf{{Pranala mati|date=Mei 2021 |bot=InternetArchiveBot |fix-attempted=yes }}</ref>
When concentrated [[sodium hydroxide]] solution is added to lead(II) nitrate solution, [[Alkali salt|basic nitrates]] are formed, even well past the [[equivalence point]]. Up through the half equivalence point, Pb(NO<sub>3</sub>)<sub>2</sub>·Pb(OH)<sub>2</sub> predominates, then after this point Pb(NO<sub>3</sub>)<sub>2</sub>·5Pb(OH)<sub>2</sub> is formed. No simple Pb(OH)<sub>2</sub> is formed up to at least [[pH]] 12.<ref name="kirkothmer">{{cite book|first = D.F.|last = Othmer|authorlink = Donald Othmer|title = Kirk-Othmer Encyclopedia of Chemical Technology|edition = second completely revised|volume = 12 (Iron to Manganese)|year = 1967|publisher = [[John Wiley & Sons]]|location = New York|pages = &nbsp;272|isbn = 0-471-02040-0}}</ref><ref name="pauley">{{cite journal|title = Basic Salts of Lead Nitrate Formed in Aqueous Media|first = J. L.|last = Pauley|author2=M. K. Testerman |journal = [[Journal of the American Chemical Society]]|year = 1954|volume = 76|issue = 16|pages = 4220–4222|doi = 10.1021/ja01645a062}}</ref>
 
WhenKetika concentratedlarutan [[sodiumnatrium hydroxidehidroksida]] solutionpekat isditambahkan addedke todalam leadlarutan timbal(II) nitrate solutionnitrat, terbentuk [[AlkaliGaram saltalkali|basicbasa nitratesnitrat]] are formed, evenmeskipun wellsedikit past themelampaui [[equivalencetitik pointekivalen]]. UpMenuju throughsetengah thetitik halfekivalen, equivalenceterbentuk point,senyawa Pb(NO<sub>3</sub>)<sub>2</sub>·Pb(OH)<sub>2</sub> predominates, thenyang kemudian setelah titik afterini thisakan pointterbentuk Pb(NO<sub>3</sub>)<sub>2</sub>·5Pb(OH)<sub>2</sub>. isTidak formed.ada No simplepembentukan {{chem2|Pb(OH)<sub>|2</sub>}} issederhana formed up to at leastpada [[pH]] sekitar 12.<ref name="kirkothmer">{{cite book|first = D.F.|last = Othmer|authorlink = Donald Othmer|title = Kirk-Othmer Encyclopedia of Chemical Technology|edition = second completely revised|volume = 12 (Iron to Manganese)|year = 1967|publisher = [[John Wiley & Sons]]|location = New York|pages = &nbsp;272|isbn = 0-471-02040-0}}</ref><ref name="pauley">{{cite journal|title = Basic Salts of Lead Nitrate Formed in Aqueous Media|first = J. L.|last = Pauley|author2=M. K. Testerman |journal = [[Journal of the American Chemical Society]]|year = 1954|volume = 76|issue = 16|pages = 4220–4222|doi = 10.1021/ja01645a062}}</ref>
=== Complexation ===
Lead(II) nitrate is associated with interesting [[supramolecular chemistry]] because of its [[complex (chemistry)|coordination]] to [[nitrogen]] and [[oxygen]] electron-donating compounds. The interest is largely academic, but with several potential applications. For example, combining lead nitrate and [[diethylene glycol|pentaethylene glycol]] (EO<sub>5</sub>) in a solution of [[acetonitrile]] and [[methanol]] followed by slow [[evaporation]] produces a new crystalline material [Pb(NO<sub>3</sub>)<sub>2</sub>(EO<sub>5</sub>)].<ref>{{cite journal|title = Structural Chemistry of Poly (ethylene glycol). Complexes of Lead(II) Nitrate and Lead(II) Bromide|first = Robin D.|last = Rogers|author2=Andrew H. Bond |author3=Debra M. Roden |journal = [[Inorganic Chemistry (journal)|Inorg. Chem.]]|year = 1996|issue = 24|pages = 6964–6973|doi = 10.1021/ic960587b|volume = 35|pmid=11666874}}</ref> In the crystal structure for this compound, the EO<sub>5</sub> chain is wrapped around the lead ion in an [[Celestial sphere|equatorial plane]] similar to that of a [[crown ether]]. The two bidentate nitrate [[ligand]]s are in [[Cis-trans isomerism|trans configuration]]. The total [[coordination number]] is 10, with the lead ion in a bicapped [[square antiprism]] [[molecular geometry]].
 
=== Kompleksasi ===
The complex formed by lead(II) nitrate, [[lead(II) perchlorate]] and a [[thiazole|bithiazole]] bidentate N-donor ligand is binuclear, with a nitrate group bridging the lead atoms with coordination number of 5 and 6.<ref name=mahjoub>{{cite journal|title = A Dimeric Mixed-Anions Lead(II) Complex: Synthesis and Structural Characterization of [Pb<sub>2</sub>(BTZ)<sub>4</sub>(NO<sub>3</sub>)(H<sub>2</sub>O)](ClO<sub>4</sub>)<sub>3</sub> {BTZ = 4,4'-Bithiazole}|first = Ali Reza|last = Mahjoub|author2 = Ali Morsali|journal = [[Chemistry Letters]]|volume = 30|issue = 12|year = 2001|page= 1234|doi=10.1246/cl.2001.1234}}</ref> One interesting aspect of this type of complexes is the presence of a physical gap in the [[coordination sphere]]; i.e., the ligands are not placed symmetrically around the metal ion. This is potentially due to a lead [[lone pair]] of electrons, also found in lead complexes with an [[imidazole]] ligand.<ref name=wan>{{cite journal|title = 2D 4.8<sup>2</sup> Network with threefold parallel interpenetration from nanometre-sized tripodal ligand and lead(II) nitrate|authors = Shuang-Yi Wan, Jian Fan, Taka-aki Okamura, Hui-Fang Zhu, Xing-Mei Ouyang, Wei-Yin Sun and Norikazu Ueyama|journal = [[Chemical Communications|Chem. Commun.]]|year = 2002|pages = 2520–2521|doi = 10.1039/b207568g|issue = 21}}</ref>
LeadTimbal(II) nitratenitrat isterkait associated with interestingdengan [[supramolecularkimia chemistrysupramolekul]] becauseyang ofmenakjubkan itskarena [[complexkomplkes (chemistrykimia)|coordinationkoordinasinya]] todengan senyawa pendonor elektron [[nitrogen]] anddan [[oxygenoksigen]]. electron-donatingDaya compounds.tariknya Thelebih interestpada isaspek largely academicakademis, buttetapi withdengan severalbeberapa potentialaplikasi applicationspotensial. For exampleMisalnya, combiningpenggabungan leadtimbal nitratenitrat anddan [[diethyleneDietilena glycolglikol|pentaethylenepentaetilena glycolglikol]] ({{chem2|EO<sub>|5</sub>}}) indalam a solution oflarutan [[acetonitrileasetonitril]] anddan [[methanolmetanol]] followeddiikuti by slowdengan [[evaporationpenguapan]] produceslambat amenghasilkan newbahan crystallinekristal materialbaru [Pb(NO<sub>3</sub>)<sub>2</sub>(EO<sub>5</sub>)].<ref>{{cite journal|title = Structural Chemistry of Poly (ethylene glycol). Complexes of Lead(II) Nitrate and Lead(II) Bromide|first = Robin D.|last = Rogers|author2=Andrew H. Bond |author3=Debra M. Roden |journal = [[Inorganic Chemistry (journal)|Inorg. Chem.]]|year = 1996|issue = 24|pages = 6964–6973|doi = 10.1021/ic960587b|volume = 35|pmid=11666874}}</ref> InDalam thestruktur crystalkristal structuresenyawa for this compoundini, therantai {{chem2|EO<sub>|5</sub>}} chaindikelilingi isoleh wrappedion around the lead iontimbal indalan ansuatu [[CelestialSferis sphereselestial|equatorialbidang planeekuatorial]] similaryang tomirip that of adengan [[crowneter ethermahkota]]. The two bidentate nitrateDua [[ligandligan]]s arenitrat inbidentat berada dalam bentuk [[CisIsomerisme cis-trans isomerism|konfigurasi trans configuration]]. The total [[coordinationBilangan numberkoordinasi]] istotal adalah 10, with the leaddengan ion intimbal adalam bicappedstruktur [[squaregeometri antiprismmolekul]] [[molecularantiprisma geometrypersegi]].
 
TheSenyawa complexkompleks formedyang bydibentuk leadoleh timbal(II) nitratenitrat, [[leadtimbal(II) perchlorateperklorat]] anddan aligan donor N bidentat [[thiazoletiazola|bithiazolebitiazola]] bidentate N-donoradalah ligandkompleks isinti binuclearganda, withdengan agugus nitratenitrat groupmenjembatani bridgingatom thetimbal leaddengan atomsbilangan with coordination number ofkoordinasi 5 anddan 6.<ref name=mahjoub>{{cite journal|title = A Dimeric Mixed-Anions Lead(II) Complex: Synthesis and Structural Characterization of [Pb<sub>2</sub>(BTZ)<sub>4</sub>(NO<sub>3</sub>)(H<sub>2</sub>O)](ClO<sub>4</sub>)<sub>3</sub> {BTZ = 4,4'-Bithiazole}|first = Ali Reza|last = Mahjoub|author2 = Ali Morsali|journal = [[Chemistry Letters]]|volume = 30|issue = 12|year = 2001|page= 1234|doi=10.1246/cl.2001.1234}}</ref> OneSalah interestingsatu aspectaspek ofyang thismenarik typedari ofkompleks complexesjenis is the presence ofini aadalah physicaladanya gapcelah infisik thedalam [[coordinationlingkungan spherekoordinasi]]; i.e.yaitu, theligan ligandstidak areberada notsecara placedsimetris symmetricallymengelilingi aroundion the metal ionlogam. ThisHal isini potentiallyberpotensi due to a leadkarena [[lonepasangan pairelektron sunyi]] ofpada electronstimbal, alsojuga foundditemukan indalam leadkompleks complexestimbal withdengan anligan [[imidazoleimidazola]] ligand.<ref name=wan>{{cite journal|title = 2D 4.8<sup>2</sup> Network with threefold parallel interpenetration from nanometre-sized tripodal ligand and lead(II) nitrate|authors = Shuang-Yi Wan, Jian Fan, Taka-aki Okamura, Hui-Fang Zhu, Xing-Mei Ouyang, Wei-Yin Sun and Norikazu Ueyama|journal = [[Chemical Communications|Chem. Commun.]]|year = 2002|pages = 2520–2521|doi = 10.1039/b207568g|issue = 21}}</ref>
This type of chemistry is not unique to the nitrate salt; other lead(II) compounds such as [[lead(II) bromide]] also form complexes, but the nitrate is frequently used because of its solubility properties and its bidentate nature.
 
Jenis kimia ini tidak unik hanya untuk garam nitrat; senyawa timbal(II) lainnya seperti [[timbal(II) bromida]] juga membentuk kompleks, tetapi senyawa nitratnya sering digunakan karena kelarutannya dan sifat bidentatnya.
=== Oxidation and decomposition ===
Lead(II) nitrate is an [[oxidizing agent]]. Depending on the reaction, this may be due to the Pb<sup>2+</sup>(aq) ion, which has a standard [[reduction potential]] (E<sup>0</sup>) of −0.125&nbsp;V, or the nitrate ion, which under acidic conditions has an E<sup>0</sup> of +0.956&nbsp;V.<ref name="HillPetrucci">{{cite book|title = General Chemistry|publisher = Prentice Hall|location = Upper Saddle River, New Jersey|year = 1999|page = &nbsp;781|first = John W.|last = Hill|author2=Petrucci, Ralph H. |edition = 2nd|isbn = 0-13-010318-7}}</ref> The nitrate would function at high temperatures or in an acidic condition, while the lead(II) works best in a neutral aqueous solution.
 
=== Oksidasi dan dekomposisi ===
When heated, lead(II) nitrate crystals decompose to [[lead(II) oxide]], [[Oxygen#Allotropes|oxygen]] and [[nitrogen dioxide]].
LeadTimbal(II) nitratenitrat is anadalah [[oxidizing agentoksidator]]. DependingIni onbisa thedisebabkan reaction,karena this may be due to theion {{chem2|Pb<sup>|2+</sup>(aq) ion}}, whichyang has a standardmempunyai [[reductionpotensial potentialreduksi]] (E<sup>0</sup>°) ofstandar −0.,125&nbsp;V, or the nitrateatau ion, whichnitrat underyang acidicpada conditionssuasana hasasam anmempunyai E<sup>0</sup> of° +0.,956&nbsp;V.<ref name="HillPetrucci">{{cite book|title = General Chemistry|publisher = Prentice Hall|location = Upper Saddle River, New Jersey|year = 1999|page = &nbsp;781|first = John W.|last = Hill|author2=Petrucci, Ralph H. |edition = 2nd|isbn = 0-13-010318-7}}</ref> TheNitrat nitrateakan wouldberfungsi functionpada attemperatur hightinggi temperaturesatau ordalam insuasa an acidic conditionasam, whilesementara the leadtimbal(II) works best inberfungsi aoptimal neutraldalam aqueouslarutan solutionnetral.
 
Ketika dipanaskan, kristal timbal(II) nitrat terdekomposisi menjadi [[timbal(II) oksida]], [[Oksigen#alotropi|oksigen]] dan [[nitrogen dioksida]].
:2 Pb(NO<sub>3</sub>)<sub>2</sub> (s) → 2 PbO (s) + 4 NO<sub>2</sub> (g) + O<sub>2</sub> (g)
 
<center><math>2\text{ Pb(NO}_3\text{)}_{2(s)} \longrightarrow 2\text{ PbO}_{(s)} + 4\text{NO}_{2(g)} + \text{O}_{2(g)}</math></center>
Because of this property, lead nitrate is sometimes used in [[pyrotechnics]] such as [[fireworks]].<ref name="pyrotechnica"/>
 
Oleh karena sifat ini, timbal nitrat sering digunakan dalam [[piroteknik]] seperti [[kembang api]].<ref name="pyrotechnica"/>
== Applications ==
Due to the hazardous nature of lead(II) nitrate, there is a preference for using alternatives in industrial applications. In the formerly major application of [[lead paint]]s, it has largely been replaced by [[titanium dioxide]].<ref name="millennium">{{cite web|url = http://www.millenniumchem.com/Products+and+Services/Products+by+Type/Titanium+Dioxide+-+Paint+and+Coatings/r_TiO2+Fundamentals/Historical+Development+of+Titanium+Dioxide_EN.htm |title = Historical development of titanium dioxide|publisher = Millennium Inorganic Chemicals|accessdate = 2008-01-04|archiveurl = http://web.archive.org/web/20071021023341/http://www.millenniumchem.com/Products+and+Services/Products+by+Type/Titanium+Dioxide+-+Paint+and+Coatings/r_TiO2+Fundamentals/Historical+Development+of+Titanium+Dioxide_EN.htm |archivedate = October 21, 2007}}</ref> Other historical applications of lead(II) nitrate, such as in matches and fireworks, have declined or ceased as well. Current applications of lead(II) nitrate include use as a heat stabiliser in nylon and polyesters, as a coating for [[thermography|photothermographic]] paper, and in [[rodenticide]]s.<ref name="greenwood"/>
 
== Aplikasi ==
On a laboratory scale, lead(II) nitrate provides one of two convenient and reliable sources of [[dinitrogen tetroxide]]. By carefully drying lead(II) nitrate and then heating it in a steel vessel, [[nitrogen dioxide]] is produced, which dimerizes into the desired compound.
DueKarena tosifat the hazardous nature of leadtimbal(II) nitrate,nitrat thereyang isberbahaya, aada preferencepreferensi foruntuk usingmenggunakan alternativesalternatif indalam industrialaplikasi applicationsindustri. InSebelumnya, theaplikasi formerlyutama major application ofadalah [[leadcat painttimbal]]s, itsekarang hassebagian largelybesar beentelah replaceddigantikan bydengan [[titanium dioxidedioksida]].<ref name="millennium">{{cite web|url = http://www.millenniumchem.com/Products+and+Services/Products+by+Type/Titanium+Dioxide+-+Paint+and+Coatings/r_TiO2+Fundamentals/Historical+Development+of+Titanium+Dioxide_EN.htm |title = Historical development of titanium dioxide|publisher = Millennium Inorganic Chemicals|accessdate = 2008-01-04|archiveurl = httphttps://web.archive.org/web/20071021023341/http://www.millenniumchem.com/Products+and+Services/Products+by+Type/Titanium+Dioxide+-+Paint+and+Coatings/r_TiO2+Fundamentals/Historical+Development+of+Titanium+Dioxide_EN.htm |archivedate = October 2007-10-21,|dead-url 2007= yes}}</ref> OtherAplikasi historicalhistoris applicationslainnya ofdari leadtimbal(II) nitratenitrat, suchseperti asdalam inkorek matchesdan andkembang fireworksapi, havetelah declinedmenurun oratau ceasedberhenti as welltotal. CurrentAplikasi applicationstimbal of lead(II) nitratenitrat includesaat useini asmencakup apenggunaan heatsebagai stabiliserstabilisator inpanas nylondalam andnilon dan polyesterspoliester, assebagai apelapis coatinguntuk forkertas [[thermographytermografi|photothermographicfototermografi]] paper, and indan [[rodenticiderodentisida]]s.<ref name="greenwood"/>
 
Pada skala laboratorium, timbal(II) nitrat merupakan salah satu dari dua sumber [[dinitrogen tetroksida]] yang mudah dan dapat diandalkan. Mengeringkan timbal(II) nitrat dengan hati-hati dan kemudian memanaskannya dalam sebuah bejana baja, dihasilna [[nitrogen dioksida]], yang mengalami dimerisasi menjadi senyawa yang diinginkan.
:2 NO<sub>2</sub> {{unicode|⇌}} N<sub>2</sub>O<sub>4</sub>
 
<center><math>2\text{ NO}_2 \rightleftharpoons \text{N}_2\text{O}_4</math></center>
To improve the [[Tank leaching|leaching]] process in the [[gold cyanidation]], lead(II) nitrate solution is added. Although a bulk process, only limited amounts (10 to 100&nbsp;milligrams lead(II) nitrate per kilogram gold) are required.<ref>{{cite book|first = Fathi|last = Habashi|title = Recent advances in gold metallurgy|year = 1998 |journal=Revisa de la Facultad de Ingeniera, Universidad Central de Venezuela|volume=13|issue=2|pages=43–54}}</ref><ref>{{cite web|url = http://www.e-goldprospecting.com/html/auxiliary_agents_in_gold_cyani.html|title = Auxiliary agents in gold cyanidation|publisher = Gold Prospecting and Gold Mining|accessdate = 2008-01-05}}</ref> Both the cyanidation itself, as well as the use of lead compounds in the process, are deemed controversial due to the compounds' toxic nature.
 
ToUntuk improvememperbaiki theproses [[TankPelindian leachingtanki|leachingpelindian]] process({{lang-en|leaching}}) in thedalam [[goldsianidasi cyanidationemas]], leadditambahkan larutan timbal(II) nitratenitrat. solutionMeskipun isprosesnya added.meilbatkan Althoughjumlah abesar, bulkhanya process,sedikit timbal(II) onlynitrat limitedyang amountsdiperlukan (10 tosampai 100&nbsp;milligramsmiligram leadtimbal(II) nitratenitrat per kilogram goldemas) are required.<ref>{{cite book|first = Fathi|last = Habashi|title = Recent advances in gold metallurgy|year = 1998 |journal=Revisa de la Facultad de Ingeniera, Universidad Central de Venezuela|volume=13|issue=2|pages=43–54}}</ref><ref>{{cite web|url = http://www.e-goldprospecting.com/html/auxiliary_agents_in_gold_cyani.html|title = Auxiliary agents in gold cyanidation|publisher = Gold Prospecting and Gold Mining|accessdate = 2008-01-05}}</ref> BothBaik thesianidasi cyanidationitu itselfsendiri, asmaupun wellpenggunaan assenyawa thetimbal usedalam of lead compounds in the processproses, are deemeddianggap controversialkontroversial duekarena tosifat thetoksik compounds'kedua toxicsenyawa naturetersebut.
In organic chemistry, lead(II) nitrate has been used as an oxidant, for example as an alternative to the [[Sommelet reaction]] for oxidation of [[benzyl]]ic halides to aldehydes.<ref name=SchulzeBerichte1884>{{cite journal |last = Schulze
 
Dalam kimia organik, timbal(II) nitrat telah digunakan sebagai oksidan, misalnya sebagai suatu alternatif dari [[reaksi Sommelet]] untuk oksidasi [[benzil]] halida menjadi aldehida.<ref name=SchulzeBerichte1884>{{cite journal |last = Schulze
| first = K. E. |title = Über α- und β-Methylnaphtalin
| journal = [[Berichte der deutschen chemischen Gesellschaft|Chemische Berichte]]
| volume = 17|page = 1530|year = 1884|doi=10.1002/cber.188401701384}}</ref> It{{chem2|Pb(NO|3|)|2}} hasjuga alsodijumpai founddigunakan usedalam in the preparation ofpreparasi [[isothiocyanateisotiosianat]]s fromdari [[dithiocarbamateditiokarbamat]]s.<ref name="OrgSynDains">{{OrgSynth|author =Dains, F. B.; Brewster, R. Q.; Olander, C. P. |title = Phenyl isothiocyanate|collvol = 1|collvolpages = 447|prep = cv1p0447}}</ref> BecauseKarena ofsifat itstoksiknya toxicitytimbal(II) itnitrat hasmulai largelyjarang fallen out of favourdigunakan, buthanya itaplikasi-aplikasi stillterbatas findsyang occasionalmasih usemenggunakannya, forseperti exampleperaup as a({{lang-en|scavenger}}) [[bromidebromida]] scavenger duringselama [[Reaksi SN1|substitusi reaction{{chem2|SN|S<sub>N</sub>1 substitution}}]].<ref name="OrgSynRapoport">
{{OrgSynth|author = Rapoport, H.; Jamison, T.|collvol = 9|collvolpages = 344|prep = cv9p0344|year = 1998|title = (S)-N-(9-Phenylfluoren-9-yl)alanine and (S)-Dimethyl-N-(9-phenylfluoren-9-yl)aspartate}}</ref>
 
== SafetyKeselamatan ==
{{mainUtama|LeadKeracunan poisoningtimbal}}
LeadTimbal(II) nitratenitrat isbersifat toxictoksik, anddan ingestionjika maytertelan leaddapat tomenyebabkan acutekeracunan leadtimbal poisoning,akut. asIni isberlaku applicableterutama foruntuk allseluruh solublesenyawa leadtimbal yang dapat compoundslarut.<ref name="icsc">{{cite web|title = Lead nitrate, Chemical Safety Card 1000|url = http://www.inchem.org/documents/icsc/icsc/eics1000.htm |publisher = [[International Labour Organization]], International Occupational Safety and Health Information Centre|date=March 1999|accessdate = 2008-01-19}}</ref> AllSeluruh [[Inorganic compounds by element#Lead (Plumbum)Timbal|inorganicsenyawa leadtimbal compoundsanorganik]] arediklasifikasikan classified by theoleh [[InternationalBadan AgencyInternasional forPenelitian Research on CancerKanker]] (IARC) assebagai [[List ofDaftar IARC GroupGolongan 2A carcinogenskarsinogen|probablyberpotensi carcinogenickarsinogen topada humansmanusia]] (CategoryKategori&nbsp;2A).<ref name="IARC1">{{cite journal|publisher = [[International Agency for Research on Cancer]]|year = 1987|url = http://monographs.iarc.fr/ENG/Monographs/suppl7/suppl7.pdf|format = PDF|title = Inorganic and Organic Lead Compounds|journal = IARC Monographs on the Evaluation of Carcinogenic Risks to Humans|volume = Suppl. 7|accessdate = 2008-01-19|pages = &nbsp;239}}</ref> TheyMereka haveterkait been linked todengan [[renalkarsinoma cellsel carcinomaginjal|renalkanker cancerginjal]] anddan [[glioma]] indalam experimentalpercobaan animalspada andbinatang tountuk renalkanker cancerginjal, [[brainTumor tumorotak|brainkanker cancerotak]] anddan [[lungkanker cancerparu-paru]] indalam humansmanusia, althoughmeskipun studiesstudi ofterhadap workerspekerja exposedyang toterpapar leadtimbal aresering oftenkali complicatedrumit bykarena concurrentbersamaan exposuredengan topaparan [[arsenicarsenik]].<ref name="IARC2">{{cite journal|publisher = [[International Agency for Research on Cancer]]|year = 2006|url = http://monographs.iarc.fr/ENG/Monographs/vol87/volume87.pdf|format = PDF|title = Inorganic and Organic Lead Compounds|journal = IARC Monographs on the Evaluation of Carcinogenic Risks to Humans|volume = 87|isbn=92-832-1287-8|accessdate = 2008-01-01|author = World Health Organization, International Agency for Research on Cancer.}}</ref> LeadTimbal isdikenal knownsebagai to substitute forpengganti [[zincseng]] indalam a number ofsejumlah [[enzymeenzim]]s, includingtermasuk [[porphobilinogenporfobilinogen synthasesintase|δ-aminolevulinicasam acidaminolevulinat dehydratasedehidratase]] (porphobilinogenporfobilinogen synthasesintase) indalam thejalur biosintesis [[heme|haem]] biosynthetic pathway anddan [[NucleotidaseNukleotidase|pyrimidinepirimidin-5′-nucleotidasenukleotidase]], importantyang forpenting thebagi correct metabolism ofmetabolisme [[DNA]] andyang baik dan canoleh thereforekarenanya causemenyebabkan fetalkerusakan damagejanin.<ref name=mohammed>{{cite journal|last = Mohammed-Brahim|first = B.|author2 = Buchet, J.P. |author3=Lauwerys, R. |title = Erythrocyte pyrimidine 5'-nucleotidase activity in workers exposed to lead, mercury or cadmium|journal = Int Arch Occup Environ Health|year = 1985|volume = 55|issue = 3|pages = 247–52|pmid = 2987134|doi = 10.1007/BF00383757}}</ref>
-->
== Lihat juga ==
{{portal|Kimia}}
Baris 157:
 
== Pranala luar ==
{{Commons category|Lead(II) nitrate|Timbal(II) nitrat}}
* {{cite journal|last = Woodbury|first = William D.|title = Lead|url = http://digicoll.library.wisc.edu/cgi-bin/EcoNatRes/EcoNatRes-idx?type=article&did=ECONATRES.MINYB1982V1.WWOODBURY&isize= |journal = Mineral yearbook metals and minerals|year = 1982|publisher = [[United States Bureau of Mines|Bureau of Mines]]|pages = &nbsp;515–42|accessdate = 2008-01-18}}
* {{cite journal|title = Lead|url = http://www.cdc.gov/niosh/npg/npgd0368.html|publisher = National Institute for Occupational Safety and Health|journal = NIOSH Pocket Guide to Chemical Hazards|date=September 2005|id = NIOSH 2005-149| accessdate = 2008-01-19}}
Baris 165:
 
;Lembar Data Keselamatan Bahan (MSDS)
* [http://physchem.ox.ac.uk/MSDS/LE/lead_nitrate.html MSDS timbal nitrat, PTCL, Oxford University] {{Webarchive|url=https://web.archive.org/web/20070916040907/http://physchem.ox.ac.uk/MSDS/LE/lead_nitrate.html |date=2007-09-16 }}
* {{PDFlink|[http://www.proscitech.com.au/cataloguex/msds/c151.pdf MSDS for lead nitrate, ProSciTech]|126&nbsp;[[Kibibyte|KiB]]<!-- application/pdf, 129167 bytes -->}}
* [http://www.sciencestuff.com/msds/C1980.html MSDS timbal nitrat, Science Stuff Inc] {{Webarchive|url=https://web.archive.org/web/20060328120306/http://www.sciencestuff.com/msds/C1980.html |date=2006-03-28 }}
* [http://avogadro.chem.iastate.edu/MSDS/Pb(NO3)2.htm MSDS timbal nitrat, Iowa State University] {{Webarchive|url=https://web.archive.org/web/20060504233922/http://avogadro.chem.iastate.edu/MSDS/Pb(NO3)2.htm |date=2006-05-04 }}
* [https://srmors.nist.gov/msds/view_msds2pdf.cfm?msds=991 MSDS timbal nitrat, NIST]{{Pranala mati|date=Maret 2021 |bot=InternetArchiveBot |fix-attempted=yes }}
 
{{Senyawa timbal}}
{{nitrat}}
 
{{DEFAULTSORT:Timbal(IiII) Nitrat}}
[[Kategori:Karsinogen IARC Golongan 2A karsinogen]]
[[Kategori:Senyawa timbal(II)]]
[[Kategori:Nitrat]]
[[Kategori:Oksidator]]