Lamotrigin: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
WanaraLima (bicara | kontrib) Dibuat dengan menerjemahkan halaman "User:Mr. Ibrahem/Lamotrigine" |
+ 5 Kategori; ± 2 Kategori menggunakan HotCat |
||
| (2 revisi perantara oleh 2 pengguna tidak ditampilkan) | |||
Baris 1:
{{Infobox drug
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 420280917
| drug_name =
| INN =
| image =
| width = 150px
| alt =
| image2 =
| width2 = 150px
| alt2 =
| caption =
| imageL = Lamotrigine.svg
| widthL =
| altL =
| imageR = Lamotrigine ball-and-stick model.png
| widthR =
| altR =
| type = <!-- empty -->
<!-- Names -->
| pronounce = {{IPAc-en|l|ə|ˈ|m|oʊ|t|r|ᵻ|ˌ|dʒ|iː|n}}
| tradename = Lamictal, others<ref name=brands>{{cite web|title=Lamotrigine|url=https://www.drugs.com/international/lamotrigine.html|website=Drugs.com|access-date=9 December 2017|archive-date=10 December 2017|archive-url=https://web.archive.org/web/20171210072144/https://www.drugs.com/international/lamotrigine.html|url-status=live}}</ref>
| synonyms = BW-430C; BW430C; 3,5-Diamino-6-(2,3-dichlorophenyl)-1,2,4-triazine
| INN =
| IUPAC_name = 6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine
<!-- Clinical data -->
| class = [[Anticonvulsant]]<ref name=AHFS2017 />
| uses = [[Epilepsy]], [[bipolar disorder]]<ref name=AHFS2017 />
| side_effects = Sleepiness, headache, vomiting, trouble with coordination, rash<ref name=AHFS2017 />
| interactions = <!-- notable interactions -->
| pregnancy_AU = D
| pregnancy_AU_comment= <ref name="Drugs.com pregnancy">{{cite web | title=Lamotrigine Use During Pregnancy | website=Drugs.com | date=8 October 2019 | url=https://www.drugs.com/pregnancy/lamotrigine.html | access-date=24 March 2020 | archive-date=25 January 2021 | archive-url=https://web.archive.org/web/20210125224408/https://www.drugs.com/pregnancy/lamotrigine.html | url-status=live }}</ref>
| pregnancy_US = C
| pregnancy_US_comment= <ref name="Drugs.com pregnancy" />
| pregnancy_category=
| breastfeeding =
| routes_of_administration= [[Oral administration|By mouth]]
| onset =
| duration_of_action=
| defined_daily_dose=
| typical_dose =
| dependency_liability=
| addiction_liability=
<!-- External links -->
| Drugs.com = {{drugs.com|monograph|lamotrigine}}
| MedlinePlus = a695007
<!-- Legal data -->
| legal_AU = S4
| legal_AU_comment =
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F-->
| legal_BR_comment =
| legal_CA = Rx-only
| legal_CA_comment =
| legal_DE = <!-- Anlage I, II, III or Unscheduled-->
| legal_DE_comment =
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment =
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV-->
| legal_UN_comment =
| legal_UK = POM
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment =
| legal_status = <!--For countries not listed above-->
| DailyMedID = Lamotrigine
| licence_US = Lamotrigine
| licence_CA = <!-- Health Canada may use generic or brand name (generic name preferred) -->
| licence_EU = <!-- EMA uses INN (or special INN_EMA) -->
<!-- Pharmacokinetic data -->
| bioavailability = 98%
| protein_bound = 55%
| metabolism = [[Liver]] (mostly [[UGT1A4]]-mediated)
| metabolites =
| elimination_half-life= 29 hours
| excretion = [[Urine]] (65%), [[feces]] (2%)
<!-- Chemical and physical data -->
| C= 9 | Cl= 2 | H= 7 | N= 5
| SMILES = NC1=NC(N)=NN=C1C2=CC=CC(Cl)=C2Cl
| StdInChI = 1S/C9H7Cl2N5/c10-5-3-1-2-4(6(5)11)7-8(12)14-9(13)16-15-7/h1-3H,(H4,12,13,14,16)
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_comment =
| StdInChIKey = PYZRQGJRPPTADH-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| Jmol =
| molecular_weight = 256.091
| molecular_weight_unit= g/mol
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
'''Lamotrigin''' adalah [[Antikejang|obat antikonvulsan]] yang diindikasikan untuk mengatasi [[epilepsi]] dan juga [[gangguan bipolar]] . <ref name=AHFS2017>{{cite web|title=Lamotrigine|url=https://www.drugs.com/monograph/lamotrigine.html|publisher=The American Society of Health-System Pharmacists|access-date=8 December 2017|archive-date=10 December 2017|archive-url=https://web.archive.org/web/20171210020403/https://www.drugs.com/monograph/lamotrigine.html|url-status=live}}</ref> Lamotrigin untuk penderita epilepsi, mengatasi kejadian kejang fokal, kejang tonik-klonik, dan juga obat ini mengatasi kejang pada sindrom Lennox-Gastaut . <ref name=AHFS2017 /> Untuk gangguan bipolar, lamotrigin digunakan untuk mengatasi depresi akut dan juga mengatasi [[Gangguan bipolar|siklus cepat]] pada [[Gangguan bipolar tipe II|bipolar tipe II]], lamotrigin juga bisa digunakan untuk pencegahan kekambuhan pada pasien [[Gangguan bipolar tipe I|bipolar tipe I.]] <ref name=AHFS2017 />
== Referensi ==
[[Kategori:Antikejang]]
[[Kategori:Obat yang dikembangkan oleh GSK plc]]
[[Kategori:Kloroarena]]
[[Kategori:Dermatoksin]]
[[Kategori:Triazina]]
[[Kategori:Obat dengan cara kerja yang belum diketahui]]
[[Kategori:Obat Esensial Organisasi Kesehatan Dunia]]
| |||