Eritromisin: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
−Kategori:Makrolida; + 6 Kategori; ± 3 Kategori menggunakan HotCat |
||
(2 revisi perantara oleh satu pengguna lainnya tidak ditampilkan) | |||
Baris 1:
{{Infobox drug
| Watchedfields = changed
| verifiedrevid = 464189839
| image = Erythromycin A skeletal.svg
| width = 200
| alt =
| image2 = Erythromycin_3d_structure.png
| width2 =
| alt2 =
| caption =
<!-- Clinical data -->
| pronounce =
| tradename = Eryc, Erythrocin, dll<ref name=AHFS2015/>
| Drugs.com = {{drugs.com|monograph|erythromycin}}
| MedlinePlus = a682381
| DailyMedID = Erythromycin
| pregnancy_AU = A
| pregnancy_AU_comment = <ref name=AG2015/>
| pregnancy_category =
| routes_of_administration = Oral intravena, [[Penyuntikan intraotot|intramuskular]], [[topikal]], [[tetes mata]]
| class = [[Macrolide antibiotic]]
| ATC_prefix = D10
| ATC_suffix = AF02
| ATC_supplemental = {{ATC|J01|FA01}} {{ATC|S01|AA17}} {{ATCvet|J51|FA01}}
<!-- Legal status -->
| legal_AU = S4
| legal_AU_comment =
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F -->
| legal_BR_comment =
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA_comment =
| legal_DE = <!-- Anlage I, II, III or Unscheduled -->
| legal_DE_comment =
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment =
| legal_UK = POM
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment =
| legal_EU =
| legal_EU_comment =
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
| legal_UN_comment =
| legal_status = <!-- For countries not listed above -->
<!-- Pharmacokinetic data -->
| bioavailability = Tergantung pada jenis ester; antara 30% dan 65%
| protein_bound = 90%
| metabolism = Hati (di bawah 5% diekskresikan tidak berubah)
| metabolites =
| onset =
| elimination_half-life = 1.5 jam
| duration_of_action =
| excretion = Empedu
<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 114-07-8
| CAS_supplemental =
| PubChem = 12560
| IUPHAR_ligand = 1456
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00199
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 12041
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 63937KV33D
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00140
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 42355
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 532
| NIAID_ChemDB =
| PDB_ligand = ERY
| synonyms =
<!-- Chemical and physical data -->
| IUPAC_name = (3''R'',4''S'',5''S'',6''R'',7''R'',9''R'',11''R'',12''R'',13''S'',14''R'')-6-{[(2''S'',3''R'',4''S'',6''R'')-4-(Dimetilamino)-3-hidroksi-6-metiloksan-2-il]oksi}-14-etil-7,12,13-trihidroksi-4-{[(2''R'',4''R'',5''S'',6''S'')-5-hidroksi-4-metoksi-4,6-dimetiloksan-2-il]oksi}-3,5,7,9,11,13-heksametil-1-oksasiklotetradekana-2,10-diona
| C=37 | H=67 | N=1 | O=13
| SMILES = CC[C@@H]1[C@@]([C@@H]([C@H](C(=O)[C@@H](C[C@@]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O[C@H]2C[C@@]([C@H]([C@@H](O2)C)O)(C)OC)C)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)(C)O)C)C)O)(C)O
| Jmol = none <!-- SMILES renders as flat -->
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C37H67NO13/c1-14-25-37(10,45)30(41)20(4)27(39)18(2)16-35(8,44)32(51-34-28(40)24(38(11)12)15-19(3)47-34)21(5)29(22(6)33(43)49-25)50-26-17-36(9,46-13)31(42)23(7)48-26/h18-26,28-32,34,40-42,44-45H,14-17H2,1-13H3/t18-,19-,20+,21+,22-,23+,24+,25-,26+,28-,29+,30-,31+,32-,34+,35-,36-,37-/m1/s1
| StdInChI_comment =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ULGZDMOVFRHVEP-RWJQBGPGSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
'''Eritromisin''' merupakan antibiotik golongan [[makrolida]]. Sebagaimana [[antibiotik]] golongan makrolida pada umumnya, obat ini juga mempunyai persamaan yaitu terdapatnya cincin lakton yang besar dalam rumus molekulnya.
==Asal dan kimia==
Baris 132 ⟶ 233:
== Rujukan ==
<references />
[[Kategori:Alkohol tersier]]
[[Kategori:Antibiotik
[[Kategori:
[[Kategori:
[[Kategori:Obat Esensial Nasional Indonesia]]
[[Kategori:
[[Kategori:Eter]]
[[Kategori:Hepatotoksin]]
[[Kategori:Lakton]]
[[Kategori:Obat yang dikembangkan oleh Eli Lilly and Company]]
[[Kategori:Obat yang dikembangkan oleh Pfizer]]
|