Asam retinoat: Perbedaan antara revisi

Konten dihapus Konten ditambahkan
ESCa (bicara | kontrib)
k new fwd
 
+Kategori:Persinyalan sel; ± 4 Kategori menggunakan HotCat
 
(19 revisi perantara oleh 9 pengguna tidak ditampilkan)
Baris 1:
{{chembox
#ALIH [[Vitamin A]]
| verifiedrevid = 307665518
| Name = All-trans-retinoic acid
| ImageFile = All-trans-Retinsäure.svg
| ImageSize = 350px
| IUPACName = (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid
| OtherNames = vitamin A acid; RA
| Section1 = {{Chembox Identifiers
| CASNo_Ref = {{cascite}}
| CASNo = 302-79-4
| PubChem = 444795
| SMILES = CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C(=O)O)/C)/C}}
| Section2 = {{Chembox Properties
| Formula = C<sub>20</sub>H<sub>28</sub>O<sub>2</sub>
| MolarMass= 300.43512 g/mol
| Appearance = yellow to light orange crystalline powder with characteristic floral odor<ref name="Merck">''Merck Index'', 13th Edition, '''8251'''.</ref>
| Density=
| MeltingPt = 180-182&nbsp;°C, crystals from ethanol<ref name="Merck"/>
| BoilingPt =
| Solubility = nearly insoluble
| SolubleOther = soluble
| Solvent = fat}}
| Section7 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| Autoignition = }}
| OtherFunctn =
| Function =
| OtherCpds = [[retinol]]; [[retinal]]; [[beta-carotene]]
}}
'''Asam retinoat''' ({{lang-en|retinoic acid, retinoate}}) adalah [[senyawa organik|senyawa]] [[metabolit]] [[retinol|vitamin A]]. Baik [[retinol]], asam retinoat dan beberapa [[retinoid]] sintetik merupakan komponen intrinsik yang penting dalam regulasi [[diferensiasi]] [[sel epitelial]] dan pencegahan [[neoplasma]]. Asam retinoat meningkatkan produksi aktivator [[plasminogen]] jaringan, yang memicu peningkatan aktivitas [[plasmin]] seluler dan mengaktivasi [[hormon TGF|TGF-β]].<ref>{{en}} {{cite web
| url = http://www.ncbi.nlm.nih.gov/pmc/articles/PMC2248210
| title = On the role of transforming growth factor-β in the growth inhibitory effects of retinoic acid in human pancreatic cancer cells
| accessdate = 2010-12-08
| work = Department of Surgery and Robert H Lurie Comprehensive Cancer Center, Northwestern University Feinberg School of Medicine, Department of Biomedical Sciences, Creighton University, Department of Physiology, Faculty of Medicine and Health Sciences, United Arab Emirates University; Brahmchetna Singh, Richard F Murphy, Xian-Zhong Ding, Alexandra B Roginsky, Richard H Bell, Jr, dan Thomas E Adrian
}}</ref>
 
Pada model [[ayam]], asam retinoat menunjukkan efektivitas lebih tinggi daripada retinol saat mengubah [[metaplasia]] yang menjadi telah [[keratin]], menjadi metaplasia [[mukus]].<ref>{{en}} {{cite web
[[Kategori:Asam organik]]
| url = http://www.ncbi.nlm.nih.gov/pmc/articles/PMC1184018/pdf/biochemj00487-0195.pdf
| title = Determination of Binding Affinities of Retinoids to Retinoic Acid-Binding Protein and Serum Albumin
| accessdate = 2010-12-08
| work = Southern Research Institute; BRAHMA P. SANI, BELINDA C. TITUS dan CHANDRA K. BANERJEE
}}</ref> ''Methylketocyclopentenyl'' dan 1-''methoxyethylcyclopentenyl'', senyawa analog dari asam retinoat-β, paling tidak 50 kali lebih efektif daripada asam retinoat, untuk menghambat [[hiperplasia]] yang diinduksi oleh [[karsinogen]].<ref>{{en}} {{cite web
| url = http://www.ncbi.nlm.nih.gov/pmc/articles/PMC1801872/pdf/canmedaj01131-0025.pdf
| title = Inhibition of carcinogenesis by retinoids
| accessdate = 2010-12-08
| work = PAUL NETTESHEIM
}}</ref>
 
Senyawa [[retinoid]] asam retinoat lain, seperti ''all-trans retinoic acid'', ''13-cis retinoic acid'', dan ''arotinoid Ro 13-6298'', sangat efektif menghambat aktivitas [[transglutaminase]] pada [[sel kanker|sel]] [[karsinoma skuamus]] SCC-13, tanpa adanya [[hormon]] ''hydrocortisone''.<ref>{{en}} {{cite web
| url = http://www.ncbi.nlm.nih.gov/pubmed/2862088
| title = Retinoid suppression of transglutaminase activity and envelope competence in cultured human epidermal carcinoma cells. Hydrocortisone is a potent antagonist or retinyl acetate but not retinoic acid.
| accessdate = 2010-12-11
| work = Thacher SM, Coe EL, Rice RH.
}}</ref>
 
== Pranala luar ==
* {{en}}[http://www.ncbi.nlm.nih.gov/pmc/articles/PMC370976/pdf/jcinvest00478-0029.pdf Retinoic Acid, INHIBITION OF THE CLONAL GROWTH OF HUMAN MYELOID LEUKEMIA CELLS]
* {{en}}[http://www.ncbi.nlm.nih.gov/pmc/articles/PMC345571/pdf/pnas00615-0047.pdf Differences in keratin synthesis between normal epithelial cells and squamous cell carcinomas are mediated by vitamin A]
* {{en}}[http://www.ncbi.nlm.nih.gov/pmc/articles/PMC1801872/pdf/canmedaj01131-0025.pdf Inhibition of carcinogenesis by retinoids]
 
== Rujukan ==
{{reflist}}
{{Biokimia-stub}}
{{Authority control}}
[[Kategori:Komunikasi sel]]
[[Kategori:Asam organikkarboksilat]]
[[Kategori:Apokarotenoid]]
[[Kategori:Sikloheksana]]
[[Kategori:Obat Esensial Nasional Indonesia]]
[[Kategori:Persinyalan sel]]