Desloratadin: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
menambahkan pranala |
Add 1 book for Wikipedia:Pemastian (20240709)) #IABot (v2.0.9.5) (GreenC bot |
||
| (9 revisi perantara oleh 3 pengguna tidak ditampilkan) | |||
Baris 1:
{{Infobox drug
| verifiedrevid = 460777963
| image = Desloratadine.svg
| width = 222
| alt =
| image2 = Desloratadine 3D ball-and-stick.png
| alt2 =
<!-- Clinical data -->
| pronounce =
| tradename = Clarinex, Aerius, Allex, dll<ref name="murdoch">{{cite journal | vauthors = Murdoch D, Goa KL, Keam SJ | title = Desloratadine: an update of its efficacy in the management of allergic disorders | journal = Drugs | volume = 63 | issue = 19 | pages = 2051–2077 | date = 7 April 2003 | pmid = 12962522 | doi = 10.2165/00003495-200363190-00010 | s2cid = 195689362 }}</ref>
| Drugs.com = {{drugs.com|monograph|desloratadine}}
| MedlinePlus = a602002
| DailyMedID = Desloratadine
| pregnancy_AU = B1
| pregnancy_AU_comment =
| pregnancy_category =
| routes_of_administration = Oral
| class =
| ATC_prefix = R06
| ATC_suffix = AX27
| ATC_supplemental =
<!-- Legal status -->
| legal_AU = S2
| legal_AU_comment =
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F -->
| legal_BR_comment =
| legal_CA = OTC
| legal_CA_comment =
| legal_DE = <!-- Anlage I, II, III or Unscheduled -->
| legal_DE_comment =
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment =
| legal_UK = POM
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment = <ref name="Clarinex FDA label">{{cite web | title=Clarinex- desloratadine tablet, film coated | website=DailyMed | date=14 November 2022 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=c671342e-69a2-4ca5-abc2-8166ed4240d4 | access-date=18 May 2024}}</ref><ref>{{cite web | title=Clarinex-D 12 HOUR- desloratadine and pseudoephedrine sulfate tablet, extended release | website=DailyMed | date=14 November 2022 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=1af66b7a-4ab8-40d8-abdd-22d3310228a8 | access-date=18 May 2024}}</ref>
| legal_EU = Rx-only
| legal_EU_comment = <ref name="Allex EPAR">{{Cite web|url=https://www.ema.europa.eu/en/medicines/human/EPAR/allex|title=Allex EPAR |website=[[European Medicines Agency]] (EMA) | date=19 May 2004 }}</ref>
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
| legal_UN_comment =
| legal_status = <!-- For countries not listed above -->
<!-- Pharmacokinetic data -->
| bioavailability = Diserap dengan cepat
| protein_bound = 83 – 87%
| metabolism = [[UGT2B10]], [[CYP2C8]]
| metabolites = 3-Hydroxydesloratadine
| onset = within 1 hour<ref name="Lieberman_2008"/>
| elimination_half-life = 27 jam,<ref name="Lieberman_2008">{{cite book | vauthors = Lieberman P, Hernandez-Trujillo V, Lieberman J, Frew AJ | title=Clinical Immunology | url = https://archive.org/details/clinicalimmunolo0000unse_l3k4 | chapter=Antihistamines | publisher=Elsevier | year=2008 | doi=10.1016/b978-0-323-04404-2.10089-2 | pages=[https://archive.org/details/clinicalimmunolo0000unse_l3k4/page/1317 1317]–1329 | isbn=9780323044042 }}</ref> 33.7 jam pada pasien yang tua<ref name="Clarinex FDA label">{{cite web | title=Clarinex- desloratadine tablet, film coated | website=DailyMed | date=14 November 2022 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=c671342e-69a2-4ca5-abc2-8166ed4240d4 | access-date=18 May 2024}}</ref>
| duration_of_action = up to 24 hours<ref name="Lieberman_2008"/>
| excretion = 40% sebagai metabolit terkonjugasi dalam urin Jumlah yang sama masuk ke dalam tinja
<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 100643-71-8
| CAS_supplemental =
| PubChem = 124087
| IUPHAR_ligand = 7157
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00967
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 110575
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = FVF865388R
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D03693
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 291342
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1172
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = deskarboetoksiloratadin<ref name="loratadine-fda-2000">{{cite web |author1=Schering Corporation |title=CLARITIN brand of Loratadine - Full Prescribing Information (US FDA) |url=https://www.accessdata.fda.gov/drugsatfda_docs/label/2000/20641s7lbl.pdf |website=US FDA |access-date=17 May 2024 |date=2000 |quote="loratadine is metabolized to descarboethoxyloratadine predominantly by cytochrome P450 3A4 (CYP3A4) and, to a lesser extent, by cytochrome P450 2D6 (CYP2D6)."}}</ref>
<!-- Chemical and physical data -->
| IUPAC_name = 8-kloro-6,11-dihidro-11-(4-piperdinilidena)- 5''H''-benzo[5,6]siklohepta[1,2-b]piridin
| C=19 | H=19 | Cl=1 | N=2
| smiles = Clc4cc2c(C(/c1ncccc1CC2)=C3/CCNCC3)cc4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H19ClN2/c20-16-5-6-17-15(12-16)4-3-14-2-1-9-22-19(14)18(17)13-7-10-21-11-8-13/h1-2,5-6,9,12,21H,3-4,7-8,10-11H2
| StdInChI_comment =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JAUOIFJMECXRGI-UHFFFAOYSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
'''Desloratadin''' adalah trisiklik [[Antihistamin|Antihistamin H<sub>1</sub>]] yang digunakan untuk mengobati [[alergi]]. [[Senyawa kimia]] ini merupakan [[metabolit]] aktif dari [[loratadin]]. [[Nama dagang]]<nowiki/>nya adala Clarinex di [[Amerika Serikat]] dan Aerius di [[Eropa]] dan [[Kanada]].
==Referensi==
{{Reflist}}
[[Kategori:Obat selektif periferal]]
[[Kategori:Antihistamin]]
[[Kategori:Antagonis reseptor H1]]
[[Kategori:Kloroarena]]
[[Kategori:Heterosiklik nitrogen]]
[[Kategori:Senyawa heterosiklik dengan 3 cincin]]
[[Kategori:Metabolit obat manusia]]
[[Kategori:Piperidina]]
[[Kategori:Obat yang dikembangkan oleh Merck & Co.]]
[[Kategori:Obat yang dikembangkan oleh Schering-Plough]]
{{Farmasi-stub}}
| |||