Siklizina: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan |
k Kunci baru untuk Kategori:Siklizina: " " menggunakan HotCat |
||
(12 revisi perantara oleh 6 pengguna tidak ditampilkan) | |||
Baris 1:
{{Drugbox
'''Siklizin''' adalah jenis obat yang termasuk dalam golongan [[antihistamin]] digunakan untuk mengatasi rasa mual, mabuk, dan pusing.<ref name=":0">{{Cite web|url=https://www.medicines.org.uk/emc/medicine/27036|title=Cyclizine 50mg Tablets - Summary of Product Characteristics (SmPC) - (emc)|website=www.medicines.org.uk|access-date=2020-02-01}}</ref><ref>{{Cite book|url=https://www.worldcat.org/oclc/1130764309|title=SLEISENGER AND FORDTRAN'S GASTROINTESTINAL AND LIVER DISEASE- 2 VOLUME SET : pathophysiology,... diagnosis, management.|last=FELDMAN, MARK. FRIEDMAN, LAWRENCE S.. BRANDT, LAWRENCE J.|date=2020|publisher=ELSEVIER - HEALTH SCIENCE|isbn=0-323-60962-7|location=[S.l.]|oclc=1130764309}}</ref> Siklizin juga dapat digunakan untuk mual setelah operasi.{{Sfn|Feldman|1978|p=207|ps="Cyclizine is useful for postoperative and other forms of acute vomitting."}} Efek samping yang umum adalah mengantuk, mulut kering, sembelit, dan masalah penglihatan. Efek samping yang lebih serius termasuk tekanan darah rendah dan retensi urin.<ref>{{Cite web|url=https://www.drugs.com/sfx/cyclizine-side-effects.html|title=Cyclizine Side Effects: Common, Severe, Long Term|website=Drugs.com|language=en|access-date=2020-02-01}}</ref> Umumnya obat ini tidak dianjurkan pada anak kecil atau penderita [[glaukoma]].<ref name=":0" /><ref>{{Cite web|url=https://www.drugs.com/mtm/cyclizine.html|title=Cyclizine Uses, Side Effects & Warnings|website=Drugs.com|language=en|access-date=2020-02-01}}</ref> Penggunaan sikizin selama kehamilan belum diteliti.<ref>{{Cite web|url=https://www.drugs.com/pregnancy/cyclizine.html|title=Cyclizine Use During Pregnancy|website=Drugs.com|language=en|access-date=2020-02-01}}</ref> ▼
| Watchedfields = changed
| verifiedrevid = 458445801
| IUPAC_name = 1-benzhydryl-4-methyl-piperazine
| image = Cyclizine2DCSD.svg
| width = 150px
| image2 = Cyclizine_3d_balls.png
| width2 = 125px
<!--Clinical data-->
| tradename = Marezine, Valoid, Nausicalm, others
| Drugs.com = {{drugs.com|CDI|cyclizine}}
| pregnancy_AU = A
| pregnancy_US = B
| legal_AU = S3
| legal_UK = P
| legal_US = OTC
| legal_status = OTC (Netherlands)
| routes_of_administration = by mouth, [[Intramuscular injection|IM]], [[Intravenous therapy|IV]]
<!--Pharmacokinetic data-->
| bioavailability =
| metabolism = ''N''-demethylated to inactive norcyclizine<ref>{{cite web|title=DrugBank: Cyclizine. Pharmacology: metabolism|url=http://www.drugbank.ca/drugs/DB01176|website=DrugBank Database|access-date=5 January 2016|url-status=live|archive-url=https://web.archive.org/web/20160130173806/http://www.drugbank.ca/drugs/DB01176|archive-date=30 January 2016}}</ref>
| elimination_half-life = 20 hours
| excretion =
<!--Identifiers-->
| IUPHAR_ligand = 7151
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 82-92-8
| ATC_prefix = R06
| ATC_suffix = AE03
| PubChem = 6726
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01176
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 6470
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = QRW9FCR9P2
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D03621
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 3994
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 648
<!--Chemical data-->
| C=18 | H=22 | N=2
| molecular_weight = 266.381 g/mol
| SMILES = CN(CC1)CCN1C(C2=CC=CC=C2)C3=CC=CC=C3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H22N2/c1-19-12-14-20(15-13-19)18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18H,12-15H2,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UVKZSORBKUEBAZ-UHFFFAOYSA-N
}}
▲'''
== Referensi ==
Baris 5 ⟶ 56:
== Daftar Pustaka ==
{{Refbegin}}{{Cite book|title=SLEISENGER AND FORDTRAN'S GASTROINTESTINAL AND LIVER DISEASE- 2 VOLUME SET : pathophysiology,... diagnosis, management|last=FELDMAN|first=MARK. FRIEDMAN, LAWRENCE S.. BRANDT, LAWRENCE J.|date=1978|publisher=ELSEVIER - HEALTH SCIENCE|isbn=0-323-60962-7|location=|pages=|oclc=130764309|ref={{sfnref|
{{Authority control}}
[[Kategori:Antiemetik]]
[[Kategori:Antagonis reseptor H1]]
[[Kategori:Siklizina| ]]
[[Kategori:Obat Esensial Organisasi Kesehatan Dunia]]
|