Tikagrelor: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
JohnThorne (bicara | kontrib) k menambahkan Kategori:Obat menggunakan HotCat |
k Removing from Category:Antiplatelet using Cat-a-lot Tag: halaman dengan galat kutipan |
||
| (13 revisi perantara oleh 6 pengguna tidak ditampilkan) | |||
Baris 1:
{{Infobox drug
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 443228756
| image = Ticagrelor.svg
| width = 200
| alt =
| image2 = Ticagrelor ball-and-stick animation.gif
| alt2 =
| caption =
<!-- Clinical data -->
| pronounce =
| tradename = Briclot, Brilinta, Brilique, dll
| Drugs.com = {{drugs.com|monograph|ticagrelor}}
| MedlinePlus = a611050
| DailyMedID = Ticagrelor
| pregnancy_AU = B1
| pregnancy_AU_comment = <ref>{{cite web | title=Updates to the Prescribing Medicines in Pregnancy database | website=Therapeutic Goods Administration (TGA) | date=12 May 2022 | url=https://www.tga.gov.au/resources/resource/guidance/updates-prescribing-medicines-pregnancy-database | access-date=13 May 2022}}</ref>
| pregnancy_category =
| routes_of_administration = Oral
| class =
| ATC_prefix = B01
| ATC_suffix = AC24
| ATC_supplemental =
<!-- Legal status -->
| legal_AU = S4
| legal_AU_comment = <ref>{{cite web | title=Ticalor; Blooms The Chemist Ticagrelor; Apo-Ticagrelor; Ticagrelor Arx (Accelagen Pty Ltd) | website=Therapeutic Goods Administration (TGA) | date=11 November 2022 | url=https://www.tga.gov.au/resources/prescription-medicines-registrations/ticalor-blooms-chemist-ticagrelor-apo-ticagrelor-ticagrelor-arx-accelagen-pty-ltd | access-date=9 April 2023}}</ref>
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F -->
| legal_BR_comment =
| legal_CA = Rx-only
| legal_CA_comment = <ref>{{cite web | title=Product monograph brand safety updates | website=Health Canada | date=February 2024 | url=https://www.canada.ca/en/health-canada/services/drugs-health-products/drug-products/drug-product-database/label-safety-assessment-update/product-monograph-brand-safety-updates.html | access-date=24 March 2024}}</ref>
| legal_DE = <!-- Anlage I, II, III or Unscheduled -->
| legal_DE_comment =
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment =
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C -->
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment = <ref name="Brilinta FDA label">{{cite web | title=Brilinta- ticagrelor tablet | website=DailyMed | date=10 August 2021 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=f7b3f443-e83d-4bf2-0e96-023448fed9a8 | access-date=19 May 2022}}</ref>
| legal_EU = Rx-only
| legal_EU_comment = <ref name="Brilique EPAR">{{cite web | title=Brilique EPAR | website=European Medicines Agency | date=17 September 2018 | url=https://www.ema.europa.eu/en/medicines/human/EPAR/brilique | access-date=18 May 2022}} Text was copied from this source which is copyright European Medicines Agency. Reproduction is authorized provided the source is acknowledged.</ref>
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
| legal_UN_comment =
| legal_status = <!-- For countries not listed above -->
<!-- Pharmacokinetic data -->
| bioavailability = 36%
| protein_bound = >99.7%
| metabolism = [[Hati]] (CYP3A4)
| metabolites =
| onset =
| elimination_half-life = 7 jam (tikagrelor), 8.5 jam metabolit aktif AR-C124910XX)
| duration_of_action =
| excretion = [[Saluran empedu]]
<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 274693-27-5
| PubChem = 9871419
| IUPHAR_ligand = 1765
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB08816
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 8047109
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = GLH0314RVC
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D09017
| ChEBI =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 398435
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = AZD-6140
<!-- Chemical and physical data -->
| IUPAC_name = (1''S'',2''S'',3''R'',5''S'')-3-[7-[(1''R'',2''S'')-2-(3,4-Difluorofenil)siklopropilamino]-5-(propiltio)- 3''H''-[1,2,3]triazolo[4,5-''d'']pirimidin-3-il]-5-(2-hidroksietoksi)siklopentana-1,2-diol
| C=23 | H=28 | F=2 | N=6 | O=4 | S=1
| SMILES = CCCSc1nc(N[C@@H]2C[C@H]2c2ccc(F)c(F)c2)c2nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c2n1
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C23H28F2N6O4S/c1-2-7-36-23-27-21(26-15-9-12(15)11-3-4-13(24)14(25)8-11)18-22(28-23)31(30-29-18)16-10-17(35-6-5-32)20(34)19(16)33/h3-4,8,12,15-17,19-20,32-34H,2,5-7,9-10H2,1H3,(H,26,27,28)/t12-,15+,16+,17-,19-,20+/m0/s1
| StdInChI_comment =
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = OEKWJQXRCDYSHL-FNOIDJSQSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
'''Tikagrelor''' adalah obat yang digunakan untuk pencegahan [[strok]], [[serangan jantung]] dan kejadian lain pada penderita [[sindrom koroner akut]], yaitu masalah suplai darah di [[arteri koroner]]. Ia bertindak sebagai [[antiplatelet]] dengan memusuhi reseptor P2Y<sub>12</sub>.<ref>{{cite journal | vauthors = Jacobson KA, Boeynaems JM | title = P2Y nucleotide receptors: promise of therapeutic applications | journal = Drug Discovery Today | volume = 15 | issue = 13–14 | pages = 570–578 | date = July 2010 | pmid = 20594935 | pmc = 2920619 | doi = 10.1016/j.drudis.2010.05.011 }}</ref> Obat tersebut diproduksi oleh [[AstraZeneca]].
Efek samping yang paling umum termasuk [[dispnea]] (kesulitan bernapas), pendarahan, dan peningkatan kadar [[asam urat]] dalam darah.<ref name="Brilique EPAR" />
Obat ini disetujui untuk penggunaan medis di Uni Eropa pada bulan Desember 2010,<ref name="Brilique EPAR" /><ref name="EPAR Brilique">{{cite web|url=http://www.ema.europa.eu/docs/en_GB/document_library/EPAR_-_Public_assessment_report/human/001241/WC500100492.pdf|title=Assessment Report for Brilique|publisher=[[European Medicines Agency]]|date=January 2011}}</ref><ref>[http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/002303/human_med_001399.jsp&murl=menus/medicines/medicines.jsp&mid=WC0b01ac058001d125 European Public Assessment Report Possia]</ref> dan di Amerika Serikat pada bulan Juli 2011.<ref name="Brilinta FDA label" /><ref>{{cite press release |url=http://www.fda.gov/NewsEvents/Newsroom/PressAnnouncements/ucm263964.htm|archive-url=https://wayback.archive-it.org/7993/20170112024017/http://www.fda.gov/NewsEvents/Newsroom/PressAnnouncements/ucm263964.htm|url-status=dead|archive-date=12 January 2017|title=FDA approves blood-thinning drug Brilinta to treat acute coronary syndromes|publisher=U.S. [[Food and Drug Administration]] (FDA)|date=20 July 2011}}</ref><ref>{{cite web | title=Drug Approval Package: Brilinta (ticagrelor) NDA #022433 | publisher=U.S. [[Food and Drug Administration]] (FDA) | date=22 August 2011 | url=https://www.accessdata.fda.gov/drugsatfda_docs/nda/2011/022433Orig1s000TOC.cfm | access-date=22 May 2021}}</ref>
== Fungsi Klinis ==
Penggunaan tikagrelor diindikasikan untuk mencegah kejadian trombosis pada pasien dengan infark miokard. Berdasarkan studi PLATO, penggunaan tikagrelor pada pasien dengan sindrom koroner akut dapat menurunkan laju kematian tanpa peningkatan risiko perdarahan dibandingkan dengan [[klopidogrel]].<ref>{{cite web|url=http://kardioipdrscm.com/6763/artikel/ticagrelor-harapan-baru-dalam-prevensi-sekunder-pada-pasien-infark-miokard/.do|title=Ticagrelor, Harapan Baru Dalam Prevensi Sekunder Pada Pasien Infark Miokard|publisher=Kardioipdrscm.com|first=S|last=Salim|date=15 February 2015}}{{Pranala mati|date=Mei 2021 |bot=InternetArchiveBot |fix-attempted=yes }}</ref>
== Referensi ==
{{reflist}}
[[Kategori:Penghambat reseptor difosfat adenosin]]
[[Kategori:Penghambat CYP3A4]]
[[Kategori:Triazolopirimidina]]
[[Kategori:Fluoroarena]]
[[Kategori:Siklopropana]]
[[Kategori:Senyawa propil]]
[[Kategori:Obat yang dikembangkan oleh AstraZeneca]]
| |||