Duloksetin: Perbedaan antara revisi

Konten dihapus Konten ditambahkan
WanaraLima (bicara | kontrib)
Artikel baru tentang topik farmasi yang masih memerlukan tambahan dan pengembangan. Artikel ini merupakan terjemahan wikipedia bahasa Inggris masih perlu ditinjau ulang juga disesuaikan dengan padanan bahasa Indonesia
Muhammad Anas Sidik (bicara | kontrib)
Tidak ada ringkasan suntingan
Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan
 
(9 revisi perantara oleh 4 pengguna tidak ditampilkan)
Baris 1:
{{Infobox drug
'''Duloxetine''' adalah obat yang digunakan untuk mengatasi [[gangguan depresi mayor]], [[Gangguan kecemasan menyeluruh|gangguan kecemasan umum]], [[fibromyalgia]], dan nyeri neuropatik . <ref name="AHFS2018">{{Cite web|title=Duloxetine|url=https://www.drugs.com/monograph/duloxetine.html|website=Monograph|publisher=The American Society of Health-System Pharmacists|archive-url=https://web.archive.org/web/20181126162525/https://www.drugs.com/monograph/duloxetine.html|archive-date=2018-11-26|access-date=2018-12-24|url-status=live}}</ref> Rute pemberian obat digunakan melalui oral. <ref name="AHFS2018">{{cite web | title = Duloxetine | work = Monograph | url = https://www.drugs.com/monograph/duloxetine.html | publisher = The American Society of Health-System Pharmacists | access-date = 2018-12-24 | archive-date = 2018-11-26 | archive-url = https://web.archive.org/web/20181126162525/https://www.drugs.com/monograph/duloxetine.html | url-status = live }}</ref>
| Verifiedfields = changed
| verifiedrevid = 460765928
| image = Duloxetine.svg
| alt =
| image2 = Duloxetine-hydrochloride-from-xtal-3D-bs-17.png
| alt2 =
 
<!--Clinical data-->
Kemunculan efek samping yang umum terjadi seperti [[Xerostomia|mulut kering]], rasa mual, rasa lelah, rasa pusing, agitasi, gangguan masalah seksual, dan meningkatnya jumlah keringat. <ref name="AHFS2018">{{Cite web|title=Duloxetine|url=https://www.drugs.com/monograph/duloxetine.html|website=Monograph|publisher=The American Society of Health-System Pharmacists|archive-url=https://web.archive.org/web/20181126162525/https://www.drugs.com/monograph/duloxetine.html|archive-date=2018-11-26|access-date=2018-12-24|url-status=live}}<cite class="citation web cs1" data-ve-ignore="true">[https://www.drugs.com/monograph/duloxetine.html "Duloxetine"]. ''Monograph''. The American Society of Health-System Pharmacists. [https://web.archive.org/web/20181126162525/https://www.drugs.com/monograph/duloxetine.html Archived] from the original on 2018-11-26<span class="reference-accessdate">. Retrieved <span class="nowrap">2018-12-24</span></span>.</cite></ref> Kemunculan efek samping yang parah seperti meningkatnya risiko ingin [[bunuh diri]], [[sindrom serotonin]], [[mania]], dan masalah hati . <ref name="AHFS2018">{{cite web | title = Duloxetine | work = Monograph | url = https://www.drugs.com/monograph/duloxetine.html | publisher = The American Society of Health-System Pharmacists | access-date = 2018-12-24 | archive-date = 2018-11-26 | archive-url = https://web.archive.org/web/20181126162525/https://www.drugs.com/monograph/duloxetine.html | url-status = live }}</ref> Sindrom penarikan antidepresan bisa terjadi jika penggunaan obat ini dihentikan secara tiba-tiba. <ref name="AHFS2018">{{cite web | title = Duloxetine | work = Monograph | url = https://www.drugs.com/monograph/duloxetine.html | publisher = The American Society of Health-System Pharmacists | access-date = 2018-12-24 | archive-date = 2018-11-26 | archive-url = https://web.archive.org/web/20181126162525/https://www.drugs.com/monograph/duloxetine.html | url-status = live }}</ref> Penggunaan untuk ibu [[Kehamilan|hamil]] berpotensi membahayakan bayi. <ref name="AHFS2018">{{cite web | title = Duloxetine | work = Monograph | url = https://www.drugs.com/monograph/duloxetine.html | publisher = The American Society of Health-System Pharmacists | access-date = 2018-12-24 | archive-date = 2018-11-26 | archive-url = https://web.archive.org/web/20181126162525/https://www.drugs.com/monograph/duloxetine.html | url-status = live }}</ref> Obat ini merupakan inhibitor reuptake serotonin-norepinefrin . <ref name="BNF76">{{Cite book|date=2018|title=British national formulary : BNF 76|publisher=Pharmaceutical Press|isbn=9780857113382|edition=76|pages=364–365}}</ref> Mekanisme kerjanya masih belum diketahui sepenuhnya secara jelas. <ref name="AHFS2018">{{cite web | title = Duloxetine | work = Monograph | url = https://www.drugs.com/monograph/duloxetine.html | publisher = The American Society of Health-System Pharmacists | access-date = 2018-12-24 | archive-date = 2018-11-26 | archive-url = https://web.archive.org/web/20181126162525/https://www.drugs.com/monograph/duloxetine.html | url-status = live }}</ref>
| tradename = Cymbalta, Ariclaim, Yentreve, dll<ref name="Drugs.com-Duloxetine-Generics"/>
| Drugs.com = {{drugs.com|monograph|duloxetine}}
| MedlinePlus = a604030
| DailyMedID = Duloxetine
| pregnancy_AU = B3
| routes_of_administration = [[Oral (rute pemberian obat) |Oral]]
| class = [[Serotonin–norepinephrine reuptake inhibitor]]
| ATC_prefix = N06
| ATC_suffix = AX21
 
| legal_AU = S4
| legal_BR = C1
| legal_BR_comment = <ref name="Diário Oficial da União-2023">{{cite web |author-link=Brazilian Health Regulatory Agency |date=31 March 2023 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=3 August 2023 |access-date=16 August 2023 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=4 April 2023}}</ref>
| legal_CA = Rx-only
| legal_UK = POM
| legal_US = Rx-only
| legal_US_comment = <ref name="DailyMed-2020" />
| legal_EU = Rx-only
| legal_EU_comment = <ref name="European Medicines Agency (EMA)-2018" /><ref name="EMA-2018-EPAR" />
 
<!--Pharmacokinetic data-->
| bioavailability = ~ 50% (32% – 80%)
| protein_bound = ~ 95%
| metabolism = [[Hati]], dua isoenzim P450, [[Sitokrom P450 2D6|CYP2D6]] and [[CYP1A2]]
| elimination_half-life = 12 jam
| excretion = 70% pada urin, 20% pada feses
 
<!--Identifiers-->
| index2_label = as HCl
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 116539-59-4
| CAS_number2_Ref = {{cascite|correct|CAS}}
| CAS_number2 = 136434-34-9
| PubChem = 60835
| IUPHAR_ligand = 202
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00476
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 54822
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = O5TNM5N07U
| UNII2_Ref = {{fdacite|correct|FDA}}
| UNII2 = 9044SC542W
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07880
| KEGG2_Ref = {{keggcite|correct|kegg}}
| KEGG2 = D01179
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 36795
| ChEBI2_Ref = {{ebicite|correct|EBI}}
| ChEBI2 = 31526
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1175
| ChEMBL2_Ref = {{ebicite|correct|EBI}}
| ChEMBL2 = 1200328
| PDB_ligand = 29E
 
<!--Chemical data-->
| IUPAC_name = (+)-(''S'')-''N''-Metil-3-(naftalen-1-iloksi)-3-(tiofen-2-il)propan-1-amina
| C=18 | H=19 | N=1 | O=1 | S=1
| smiles = CNCC[C@@H](C1=CC=CS1)OC2=CC=CC3=CC=CC=C32
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H19NOS/c1-19-12-11-17(18-10-5-13-21-18)20-16-9-4-7-14-6-2-3-8-15(14)16/h2-10,13,17,19H,11-12H2,1H3/t17-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZEUITGRIYCTCEM-KRWDZBQOSA-N
}}
 
'''DuloxetineDuloksetin''' adalah obat yang digunakan untuk mengatasi [[gangguan depresi mayor]], [[Gangguan kecemasan menyeluruh|gangguan kecemasan umum]], [[fibromyalgia]], dan nyeri neuropatik . <ref name="AHFS2018">{{Cite web|title=Duloxetine|url=https://www.drugs.com/monograph/duloxetine.html|website=Monograph|publisher=The American Society of Health-System Pharmacists|archive-url=https://web.archive.org/web/20181126162525/https://www.drugs.com/monograph/duloxetine.html|archive-date=2018-11-26|access-date=2018-12-24|url-status=live}}</ref> Rute pemberian obat digunakan melalui oral. <ref name="AHFS2018">{{cite web | title = Duloxetine | work = Monograph | url = https://www.drugs.com/monograph/duloxetine.html | publisher = The American Society of Health-System Pharmacists | access-date = 2018-12-24 | archive-date = 2018-11-26 | archive-url = https://web.archive.org/web/20181126162525/https://www.drugs.com/monograph/duloxetine.html | url-status = live }}</ref>
 
Kemunculan efek samping yang umum terjadi seperti [[Xerostomia|mulut kering]], rasa mual, rasa lelah, rasa pusing, agitasi, gangguan masalah seksual, dan meningkatnya jumlah keringat. <ref name="AHFS2018" /> Kemunculan efek samping yang parah seperti meningkatnya risiko ingin [[bunuh diri]], [[sindrom serotonin]], [[mania]], dan masalah hati . <ref name="AHFS2018" /> Sindrom penarikan antidepresan bisa terjadi jika penggunaan obat ini dihentikan secara tiba-tiba. <ref name="AHFS2018" /> Penggunaan untuk ibu [[Kehamilan|hamil]] berpotensi membahayakan bayi. <ref name="AHFS2018" /> Obat ini merupakan inhibitor reuptake serotonin-norepinefrin . <ref name="BNF76">{{Cite book|date=2018|title=British national formulary : BNF 76|publisher=Pharmaceutical Press|isbn=9780857113382|edition=76|pages=364–365}}</ref> Mekanisme kerjanya masih belum diketahui sepenuhnya secara jelas. <ref name="AHFS2018" />
 
== Referensi ==
 
[[Kategori:Obat]]
[[Kategori:Farmasi]]
<references />{{Farmasi-stub}}
 
[[Kategori:Penghambat pengambilan kembali serotonin–norepinefrin]]
[[Kategori:Penghambat CYP2D6]]
[[Kategori:Obat yang dikembangkan oleh Eli Lilly and Company]]
[[Kategori:ObatTiofena]]
[[Kategori:FarmasiEter naftol]]
[[Kategori:Amina sekunder]]
[[Kategori:Antidepresan]]