Wikipedia

Fluoksetin: Perbedaan antara revisi

Jelajahi riwayat secara interaktif
← Revisi sebelumnya
Konten dihapus Konten ditambahkan
VisualTeks wiki
InternetArchiveBot (bicara | kontrib)
Bot
695.973 suntingan
Rescuing 5 sources and tagging 0 as dead.) #IABot (v2.0.9.5
Muhammad Anas Sidik (bicara | kontrib)
25.207 suntingan
Tidak ada ringkasan suntingan
Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan
 
(7 revisi perantara oleh 3 pengguna tidak ditampilkan)
Baris 1:
{{Infobox drug
'''Fluoksetin''' adalah obat anti depresan yang dikonsumsi untuk mengatasi [[Depresi (psikologi)|depresi]], [[bulimia nervosa]], gangguan obsesif kompulsif (gangguan pikiran yang sulit hilang serta memerlukan tindakan berulang), gangguan pola makan, dan serangan kepanikan (kepanikan mendadak, ketakutan berlebih, kekhawatiran atau kecemasan terhadap suatu serangan)<ref>{{Cite web|url=https://www.medicinesforchildren.org.uk/fluoxetine-depression-obsessive-compulsive-disorder-and-bulimia-nervosa|title=Fluoxetine for depression, obsessive compulsive disorder and bulimia nervosa {{!}} Medicines for Children|website=www.medicinesforchildren.org.uk|access-date=2019-12-12|archive-date=2020-10-22|archive-url=https://web.archive.org/web/20201022063920/https://www.medicinesforchildren.org.uk/fluoxetine-depression-obsessive-compulsive-disorder-and-bulimia-nervosa|dead-url=yes}}</ref><ref>{{Cite web|url=https://medlineplus.gov/druginfo/meds/a689006.html|title=Fluoxetine: MedlinePlus Drug Information|website=medlineplus.gov|language=en|access-date=2019-12-12|archive-date=2023-06-08|archive-url=https://web.archive.org/web/20230608054044/https://medlineplus.gov/druginfo/meds/a689006.html|dead-url=no}}</ref>
| verifiedrevid = 456481815
| image = Fluoxetine.svg
| width =
| alt =
| image2 = R-and-S-fluoxetine-enantiomers-based-on-HCl-xtal-Mercury-3D-balls.png
| width2 = 250
| alt2 =
| caption = Fluoksetin (top),<br />(''R'')-fluoksetin (kiri), (''S'')-fluoksetin (kanan)
| chirality = [[Racemic mixture]]
 
<!-- Clinical data -->
Fluoksetin hanya boleh dikonsumsi dengan [[Resep dokter|resep]] dokter. Fluoksetin adalah jenis obat [[oral]] dalam bentuk [[tablet]] dan [[kapsul]].<ref name=":0">{{Cite web|url=https://www.nhs.uk/medicines/fluoxetine-prozac/|title=Fluoxetine (Prozac): an antidepressant|date=2019-01-08|website=nhs.uk|language=en|access-date=2019-12-12|archive-date=2023-05-21|archive-url=https://web.archive.org/web/20230521203152/https://www.nhs.uk/medicines/fluoxetine-prozac/|dead-url=no}}</ref> Fluoksetin merupakan obat anti depresan yang bekerja di [[saraf]] otak dengan meningkatkan aktivitas zat kimia yang disebut [[serotonin]].<ref>{{Cite web|url=https://www.medicinesforchildren.org.uk/fluoxetine-depression-obsessive-compulsive-disorder-and-bulimia-nervosa|title=Fluoxetine for depression, obsessive compulsive disorder and bulimia nervosa {{!}} Medicines for Children|website=www.medicinesforchildren.org.uk|access-date=2019-12-12|archive-date=2020-10-22|archive-url=https://web.archive.org/web/20201022063920/https://www.medicinesforchildren.org.uk/fluoxetine-depression-obsessive-compulsive-disorder-and-bulimia-nervosa|dead-url=yes}}</ref> Fluoksetin dapat dikonsumsi oleh orang dewasa dan anak-anak berusia 8 tahun lebih untuk mengatasi depresi namun tidak boleh dikonsumsi oleh penderita [[Diabetes melitus|diabetes]] karena dapat mempersulit kestabilan [[gula darah]].<ref name=":0" />
| pronounce = {{IPAc-en|f|l|u|ˈ|ɒ|k|s|ə|t|iː|n}}<br />{{respell|floo|OKS|ə|teen}}
| tradename = Elizac, Nopres, Prozac, Sarafem, dll
| Drugs.com = {{drugs.com|monograph|fluoxetine-hydrochloride}}
| MedlinePlus = a689006
| DailyMedID = Fluoxetine
| pregnancy_AU = C
| pregnancy_AU_comment =
| pregnancy_category =
| dependency_liability =
| addiction_liability = None<ref name=Hub2001>{{cite book | vauthors = Hubbard JR, Martin PR |title= Substance Abuse in the Mentally and Physically Disabled |date=2001 |publisher=CRC Press |isbn=978-0-8247-4497-7 |page=26 |url=https://books.google.com/books?id=MY1kFYk98mQC&pg=PA26 }}</ref>
| routes_of_administration = Oral
| class = [[Selective serotonin reuptake inhibitor]] (SSRI)<ref name=AHFS2015/>
| ATC_prefix = N06
| ATC_suffix = AB03
| ATC_supplemental = {{ATCvet|N06|AB03}}
 
<!-- Legal status -->
| legal_AU = S4
| legal_AU_comment = <ref>{{cite web | title=Prescription medicines: registration of new generic medicines and biosimilar medicines, 2017 | website=Therapeutic Goods Administration (TGA) | date=21 June 2022 | url=https://www.tga.gov.au/resources/publication/publications/prescription-medicines-registration-new-generic-medicines-and-biosimilar-medicines-2017 | access-date=30 March 2024}}</ref>
| legal_BR = C1
| legal_BR_comment = <ref>{{cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=31 March 2023 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=3 August 2023 |access-date=16 August 2023 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=4 April 2023}}</ref>
| legal_CA = Rx-only
| legal_CA_comment = <ref>{{cite web | title=Mental health | website=[[Health Canada]] | date=9 May 2018 | url=https://www.canada.ca/en/services/health/drug-health-products/drug-medical-device-highlights-2017/approved-drugs/mental-health.html | access-date=13 April 2024}}</ref>
| legal_DE = <!-- Anlage I, II, III or Unscheduled -->
| legal_DE_comment =
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment =
| legal_UK = POM
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment = <ref name="Prozac FDA label" /><ref name="Sarafem FDA label" />
| legal_EU = Rx-only
| legal_EU_comment =
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
| legal_UN_comment =
| legal_status = <!-- For countries not listed above -->
 
<!-- Pharmacokinetic data -->
| bioavailability = 60–80%<ref name=AHFS2015>{{cite web|title=Fluoxetine Hydrochloride|url=https://www.drugs.com/monograph/fluoxetine-hydrochloride.html|publisher=The American Society of Health-System Pharmacists|access-date=2 December 2015|url-status=live|archive-url=https://web.archive.org/web/20151208193110/http://www.drugs.com/monograph/fluoxetine-hydrochloride.html|archive-date=8 December 2015}}</ref>
| protein_bound = 94–95%<ref name="Prozac FDA label">{{cite web | title=Prozac- fluoxetine hydrochloride capsule | website=DailyMed | date=23 December 2021 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=c88f33ed-6dfb-4c5e-bc01-d8e36dd97299 | access-date=11 March 2023}}</ref>
| metabolism = Hati (kebanyakan dimediasi oleh [[Sitokrom P450 2D6|CYP2D6]])<ref name=TGA/>
| metabolites = Norfluoxetine, desmethylfluoxetine
| onset =
| elimination_half-life = 1–3 hari (akut)<br />4–6 hari (kronis)<ref name=TGA/><ref name=PK/>
| duration_of_action =
| excretion = Urin (80%), feses (15%)<ref name=TGA>{{cite web|title=Prozac Fluoxetine Hydrochloride|work=TGA eBusiness Services|publisher=Eli Lilly Australia Pty. Limited|date=9 October 2013|access-date=23 November 2013|url=https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2010-PI-04098-3|format=PDF|url-status=live|archive-url=https://web.archive.org/web/20170425231029/https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2010-PI-04098-3|archive-date=25 April 2017}}</ref><ref name=PK>{{cite journal | vauthors = Altamura AC, Moro AR, Percudani M | title = Clinical pharmacokinetics of fluoxetine | journal = Clinical Pharmacokinetics | volume = 26 | issue = 3 | pages = 201–14 | date = March 1994 | pmid = 8194283 | doi = 10.2165/00003088-199426030-00004 | s2cid = 1406955 }}</ref>
 
<!-- Identifiers -->
| index2_label = as HCl
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 54910-89-3
| CAS_number2_Ref = {{cascite|correct|CAS}}
| CAS_number2 = 56296-78-7
| CAS_supplemental =
| PubChem = 3386
| PubChem2 = 62857
| IUPHAR_ligand = 203
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00472
| DrugBank2_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank2 = DBSALT000087
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3269
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID2 = 56589
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 01K63SUP8D
| UNII2_Ref = {{fdacite|correct|FDA}}
| UNII2 = I9W7N6B1KJ
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00326
| KEGG2_Ref = {{keggcite|correct|kegg}}
| KEGG2 = D00823
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 5118
| ChEBI2_Ref = {{ebicite|correct|EBI}}
| ChEBI2 = 5119
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 41
| ChEMBL2_Ref = {{ebicite|correct|EBI}}
| ChEMBL2 = 1201082
| NIAID_ChemDB =
| PDB_ligand =
| synonyms =
 
<!-- Chemical and physical data -->
| IUPAC_name = ''N''-metil-3-fenil-3-[4-(trifluorometil)fenoksi]propan-1-amina
| C = 17| H = 18| F = 3| N = 1| O = 1
| SMILES = CNCCC(c1ccccc1)Oc2ccc(cc2)C(F)(F)F
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H18F3NO/c1-21-12-11-16(13-5-3-2-4-6-13)22-15-9-7-14(8-10-15)17(18,19)20/h2-10,16,21H,11-12H2,1H3
| StdInChI_comment =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RTHCYVBBDHJXIQ-UHFFFAOYSA-N
| density =
| density_notes =
| melting_point = 179
| melting_high = 182
| melting_notes =
| boiling_point = 395
| boiling_notes =
| solubility = 14
| sol_units =
| specific_rotation =
}}
 
'''Fluoksetin''' adalah obat anti depresan yang dikonsumsi untuk mengatasi [[Depresi (psikologi)|depresi]], [[bulimia nervosa]], gangguan obsesif kompulsif (gangguan pikiran yang sulit hilang serta memerlukan tindakan berulang), gangguan pola makan, dan serangan kepanikan (kepanikan mendadak, ketakutan berlebih, kekhawatiran atau kecemasan terhadap suatu serangan)<ref name="medicinesforchildren.org.uk">{{Cite web|url=https://www.medicinesforchildren.org.uk/fluoxetine-depression-obsessive-compulsive-disorder-and-bulimia-nervosa|title=Fluoxetine for depression, obsessive compulsive disorder and bulimia nervosa {{!}} Medicines for Children|website=www.medicinesforchildren.org.uk|access-date=2019-12-12|archive-date=2020-10-22|archive-url=https://web.archive.org/web/20201022063920/https://www.medicinesforchildren.org.uk/fluoxetine-depression-obsessive-compulsive-disorder-and-bulimia-nervosa|dead-url=yes}}</ref><ref>{{Cite web|url=https://medlineplus.gov/druginfo/meds/a689006.html|title=Fluoxetine: MedlinePlus Drug Information|website=medlineplus.gov|language=en|access-date=2019-12-12|archive-date=2023-06-08|archive-url=https://web.archive.org/web/20230608054044/https://medlineplus.gov/druginfo/meds/a689006.html|dead-url=no}}</ref>
 
Fluoksetin hanya boleh dikonsumsi dengan [[Resep dokter|resep]] dokter. Fluoksetin adalah jenis obat [[oral]] dalam bentuk [[tablet]] dan [[kapsul]].<ref name=":0">{{Cite web|url=https://www.nhs.uk/medicines/fluoxetine-prozac/|title=Fluoxetine (Prozac): an antidepressant|date=2019-01-08|website=nhs.uk|language=en|access-date=2019-12-12|archive-date=2023-05-21|archive-url=https://web.archive.org/web/20230521203152/https://www.nhs.uk/medicines/fluoxetine-prozac/|dead-url=no}}</ref> Fluoksetin merupakan obat anti depresan yang bekerja di [[saraf]] otak dengan meningkatkan aktivitas zat kimia yang disebut [[serotonin]].<ref name="medicinesforchildren.org.uk"/> Fluoksetin dapat dikonsumsi oleh orang dewasa dan anak-anak berusia 8 tahun lebih untuk mengatasi depresi namun tidak boleh dikonsumsi oleh penderita [[Diabetes melitus|diabetes]] karena dapat mempersulit kestabilan [[gula darah]].<ref name=":0" />
 
== Sejarah ==
Baris 23 ⟶ 141:
{{reflist}}
{{Authority control}}
[[Kategori:Anorektik]]
 
[[Kategori:ObatAntagonis 5-HT2C]]
[[Kategori:Antidepresan]]
[[Kategori:Obat Esensial Nasional Indonesia]]
[[Kategori:Antagonis 5-HT3]]
[[Kategori:Antikejang]]
[[Kategori:Penghambat CYP2D6]]
[[Kategori:Modulator alosterik positif reseptor GABAA]]
[[Kategori:Antagonis nikotinat]]
[[Kategori:Agonis sigma]]
[[Kategori:Eter fenol]]
[[Kategori:Amina sekunder]]
[[Kategori:Penghambat pengambilan kembali serotonin selektif]]
[[Kategori:Senyawa trifluorometil]]
[[Kategori:Obat yang dikembangkan oleh Eli Lilly and Company]]
[[Kategori:Obat Esensial Organisasi Kesehatan Dunia]]
Diperoleh dari "https://wiki-indonesia.club/wiki/Fluoksetin"