Koenzim A: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Luckas-bot (bicara | kontrib) k r2.7.1) (bot Menambah: gl:Coencima A |
Penambahan referensi #1lib1ref #1lib1refID #1lib1ref2024 |
||
| (6 revisi perantara oleh 5 pengguna tidak ditampilkan) | |||
Baris 1:
{{chembox
| Verifiedfields = changed
| verifiedrevid = 460106287
| ImageFile = Coenzym A.svg
| ImageSize = 350px
| ImageFile2 = Coenzyme-A-3D-balls.png
| ImageSize2 = 350px
| IUPACName =
| OtherNames =
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 6557
| C<sub>21</sub>H<sub>36</sub>N<sub>7</sub>O<sub>16</sub>P<sub>3</sub>S▼
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1213327
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = SAA04E81UX
| InChI = 1/C21H36N7O16P3S/c1-21(2,16(31)19(32)24-4-3-12(29)23-5-6-48)8-41-47(38,39)44-46(36,37)40-7-11-15(43-45(33,34)35)14(30)20(42-11)28-10-27-13-17(22)25-9-26-18(13)28/h9-11,14-16,20,30-31,48H,3-8H2,1-2H3,(H,23,29)(H,24,32)(H,36,37)(H,38,39)(H2,22,25,26)(H2,33,34,35)/t11-,14-,15-,16?,20-/m1/s1
|}▼
| InChIKey = RGJOEKWQDUBAIZ-DRCCLKDXBU
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
'''Koenzim A''', '''KoA''' ({{lang-en|coenzyme A, CoA, CoASH, HSCoA}}) adalah sebuah kofaktor yang dikenal karena berperan dalam [[sintesis]] dan [[oksidasi]] [[asam lemak]], serta oksidasi [[asam piruvat]] dalam siklus [[asam sitrat]]. Semua lintasan biologis yang melibatkan [[enzim]], ternyata juga memerlukan koenzim A sebagai [[substrat]]. Sebagai contoh: substrat tioester seperti [[asetil-KoA]] pada sintesis [[sisteamina]], [[asam pantotenat]], dan [[adenosin trifosfat]] (ATP).▼
| StdInChI = 1S/C21H36N7O16P3S/c1-21(2,16(31)19(32)24-4-3-12(29)23-5-6-48)8-41-47(38,39)44-46(36,37)40-7-11-15(43-45(33,34)35)14(30)20(42-11)28-10-27-13-17(22)25-9-26-18(13)28/h9-11,14-16,20,30-31,48H,3-8H2,1-2H3,(H,23,29)(H,24,32)(H,36,37)(H,38,39)(H2,22,25,26)(H2,33,34,35)/t11-,14-,15-,16?,20-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RGJOEKWQDUBAIZ-DRCCLKDXSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 85-61-0
| PubChem = 6816
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01992
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C00010
| SMILES = O=C(NCCS)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n2cnc1c(ncnc12)N)[C@H](O)[C@@H]3OP(=O)(O)O
| MeSHName = Coenzyme+A
}}
| Section2 = {{Chembox Properties
▲| Formula = C<sub>21</sub>H<sub>36</sub>N<sub>7</sub>O<sub>16</sub>P<sub>3</sub>S
| MolarMass = 767.535
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
}}
| Section3 = {{Chembox Hazards
| Solubility =
| MainHazards =
| FlashPt =
| Autoignition =
}}
▲'''Koenzim A''', '''KoA''' ({{lang-en|coenzyme A, CoA, CoASH, HSCoA}}) adalah sebuah kofaktor yang dikenal karena berperan dalam [[sintesis]] dan [[oksidasi]] [[asam lemak]], serta oksidasi [[asam piruvat]] dalam siklus [[asam sitrat]]. Koenzim A dapat ditemukan pada semua sel hidup.<ref>{{Cite book|last=Parker|first=Sybil, P|date=1984|title=McGraw-Hill Dictionary of Biology|publisher=McGraw-Hill Company|url-status=live}}</ref> Semua lintasan biologis yang melibatkan [[enzim]], ternyata juga memerlukan koenzim A sebagai [[substrat]]. Sebagai contoh: substrat tioester seperti [[asetil-KoA]] pada sintesis [[sisteamina]], [[asam pantotenat]], dan [[adenosin trifosfat]] (ATP).
== Biosintesis ==
Baris 41 ⟶ 70:
{{Commons|Coenzyme A}}
== Referensi ==
* Karl Miller (1998). [http://www.gwu.edu/~mpb/betaox.htm Beta Oxidation of Fatty Acids] {{Webarchive|url=https://web.archive.org/web/20100619135847/http://www.gwu.edu/~mpb/betaox.htm |date=2010-06-19 }}. Diperoleh 18 Mei 2005.
* Charles Ophard (2003). [http://www.elmhurst.edu/~chm/vchembook/623acetylCoAfate.html Acetyl-CoA Crossroads]. Diperoleh 18 Mei 2005.
* Lehninger: Principles of Biochemistry, 4th edition, David L. Nelson, Michael M. Cox
<references />
{{Enzim}}
[[Kategori:Enzim]]
| |||