Ksantotoksin: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan |
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
||
(11 revisi perantara oleh 4 pengguna tidak ditampilkan) | |||
Baris 1:
{{Drugbox
| verifiedrevid = 462250014
| image = Methoxsalen.svg
| alt = <!-- Clinical data -->
| pronounce =
| tradename = Oxsoralen, Uvadex, 8-mop, dll
| Drugs.com = {{drugs.com|CDI|methoxsalen}}
| MedlinePlus =
| DailyMedID = Methoxsalen
| pregnancy_AU = D
| pregnancy_AU_comment = <ref name="Uvadex APM summary">{{cite web | title=Uvadex | website=[[Therapeutic Goods Administration]] (TGA) | date=13 December 2019 | url=https://www.tga.gov.au/resources/auspmd/uvadex | access-date=25 August 2020}}</ref><ref name="AusPAR: Methoxsalen">{{cite web | title=AusPAR: Methoxsalen | website=Therapeutic Goods Administration (TGA) | date=12 December 2019 | url=https://www.tga.gov.au/auspar/auspar-methoxsalen | access-date=17 September 2021}}</ref>
| pregnancy_category =
| routes_of_administration = Ekstrakorporeal, oral
| class =
| ATC_prefix = D05
| ATC_suffix = AD02
| ATC_supplemental = {{ATC|D05|BA02}}
<!-- Legal status -->| legal_AU = S4
{{kimia-stub}}▼
| legal_AU_comment = <ref name="Uvadex APM summary" /><ref name="AusPAR: Methoxsalen" />
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F -->
| legal_BR_comment =
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA_comment =
| legal_DE = <!-- Anlage I, II, III or Unscheduled -->
| legal_DE_comment =
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment =
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C -->
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment = <ref name="Uvadex FDA label">{{cite web | title=Uvadex- methoxsalen injection, solution | website=DailyMed | publisher = U.S. National Library of Medicine | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=5ad333bd-845f-43f8-9ecf-43491f26c7c7 | access-date=17 September 2021 }}</ref><ref>{{cite web | title=Oxsoralen-Ultra- methoxsalen capsule, liquid filled | website=DailyMed | publisher = U.S. National Library of Medicine | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=ae951dc4-9031-43bf-943c-cb2366951f23 | access-date=17 September 2021}}</ref>
| legal_EU =
| legal_EU_comment =
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
| legal_UN_comment =
| legal_status = <!-- For countries not listed above -->
<!-- Pharmacokinetic data -->| bioavailability =
[[Kategori:Kimia]]▼
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life = ~2 jam
| duration_of_action =
| excretion = <!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 298-81-7
| PubChem = 4114
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00553
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3971
| NIAID_ChemDB = 001590
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = U4VJ29L7BQ
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00139
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 18358
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 416
| synonyms = metoksalen
<!-- Chemical and physical data -->| IUPAC_name = 9-metoksi-7''H''-furo[3,2-''g''][1]benzopiran-7-ona
| C = 12
| H = 8
| O = 4
| smiles = COc1c2c(ccc(=O)o2)cc3c1occ3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H8O4/c1-14-12-10-8(4-5-15-10)6-7-2-3-9(13)16-11(7)12/h2-6H,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QXKHYNVANLEOEG-UHFFFAOYSA-N
}}
'''Metoksalen''' juga dikenal sebagai '''ksantotoksin''' adalah zat organik alami dalam golongan [[furanokumarin]], diproduksi sebagai pertahanan oleh beberapa tumbuhan. Zat ini adalah turunan dari psoralen, dan secara farmakologis dan struktural terkait dengan trioksalen. Seperti yang telah disebutkan, metoksalen terdapat di alam pada berbagai tumbuhan termasuk ''[[Ammi majus]]'' ([[apiaceae]]),<ref name="Schönberg1950">{{cite web | cognome = Schönberg | nome = A. | coautori = A. Sina | titolo = Experiments with xanthotoxin and imperatorin obtained from the fruits of Ammi majus | rivista = J Am Chem Soc | volume = 72 | numero = | pagine = 4826–4828 | mese = | anno = 1950 | doi = | id = }}</ref><ref name="pmid11031774">{{cite web | cognome = Ekiert | nome = H. | coautori = E. Gomółka | titolo = Coumarin compounds in Ammi majus L. callus cultures. | rivista = Pharmazie | volume = 55 | numero = 9 | pagine = 684-7 | mese = Set | anno = 2000 | doi = | id = PMID 11031774 }}</ref><ref name="pmid20265555">{{cite web | cognome = Fahmy | nome = IR | coautori = H Abushady; A Schonberg; A Sina | titolo = A crystalline principle from Ammi majus Linn | rivista = Nature | volume = 160 | numero = | pagine = 468 | mese = | anno = 1947 | doi = | id = PMID 20265555 }}</ref><ref name="pmid18933226">{{cite web | cognome = Schonberg | nome = A | coautori = A Sina | titolo = Xanthotoxin from the fruits of Ammi majus L. | rivista = Nature | volume = 161 | numero = | pagine = 48-482 | mese = Mar | anno = 1948 | doi = | id = PMID 18933226}}</ref> ''[[Cullen corylifolium]]'' dan ''[[Ruta chalepensis]]''.<ref name="pmid14087372">{{cite web | cognome = Scheel | nome = LD | coautori = VB Perone; RL Larkin; RE Kupel | titolo = The isolation and characteria characterization of two phototoxic furanocoumarins (psoralens) from diseased celery | rivista = Biochemistry. | volume = 2 | numero = | pagine = 1127-31 | mese = Set-Ott | anno = 1963 | doi = 10.1021/bi00905a038 | id = PMID 14087372 }}</ref><ref name="pmid5031558">{{cite web | cognome = Wu | nome = CM | coautori = PE Koehler; JC Ayres | titolo = Isolation and identification of xanthotoxin (8-methoxypsoralen) and bergapten (5-methoxypsoralen) from celery infected with Sclerotinia sclerotiorum. | rivista = Appl Microbiol. | volume = 23 | numero = 5 | pagine = 852-6 | mese = Mag | anno = 1972 | url = https://www.ncbi.nlm.nih.gov/pmc/articles/PMC380460/?report=abstract | doi = | id = PMID 5031558 }}</ref> Namun, untuk penggunaan komersial dibuat melalui sintesis.<ref name="Lagercrantz1956">{{cite web | cognome = Lagercrantz | nome = Carl | coautori = | titolo = Dihydrofurocoumarins. Synthesis of some Long Chain 4-n-Alkyl Substituted Dihydroxanthotoxins, 4-Phenyl-dihydroxanthotoxin, and Methyl 8-(4-Dihydroxanthotoxin)-n-octanoate | rivista = Acta Chemica Scandinavica | volume = 10 | numero = | pagine = 647-654 | mese = | anno = 1956 | doi = 10.3891/acta.chem.scand.10-0647 | id = }}</ref><ref name="Nore1980">{{cite web | cognome = Nore | nome = Pentti | coautori = E Honkanen | titolo = A new synthesis of methoxalen | rivista = Journal of Heterocyclic Chemistry | volume = 17 | numero = 5 | pagine = 985-987 | mese = luglio | anno = 1980 | doi = 10.1002/jhet.5570170527 | id = }}</ref>
==Referensi==
{{Reflist}}
[[Kategori:Penghambat CYP1A2]]
[[Kategori:Penghambat CYP3A4]]
[[Kategori:Karsinogen IARC Golongan 1]]
[[Kategori:Furanokumarin]]
[[Kategori:Eter katekol]]
[[Kategori:Penghambat sitokrom P450 umum]]
[[Kategori:Toksin tumbuhan]]
{{Farmasi-stub}}
▲{{kimia-stub}}
|