Etambutol: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
BP49Khoirur (bicara | kontrib) Tidak ada ringkasan suntingan Tag: BP2014 |
± 4 Kategori menggunakan HotCat |
||
(18 revisi perantara oleh 13 pengguna tidak ditampilkan) | |||
Baris 1:
{{chembox
| ImageFile = Ethambutol.svg
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageName= Stereo, skeletal formula of ethambutol
| ImageFile2 = Ethambutol substance photo.jpg
| ImageFile3 = Ethambutol ball-and-stick.png
| OtherNames = (2''S'',2’''S'')-2,2’-(Ethane-1,2-diyldiimino)dibutan-1-ol<ref>{{cite web|title=ethambutol (CHEBI:4877)|url=https://www.ebi.ac.uk/chebi/searchId.do?chebiId=4877|work=Chemical Entities of Biological Interest|publisher=European Bioinformatics Institute|accessdate=26 April 2012|location=UK|date=18 August 2010|at=Main}}</ref>
|Section1={{Chembox Identifiers
| CASNo = 74-55-5
| CASNo_Ref = {{cascite|correct|??}}
| PubChem = 14052
| ChemSpiderID = 13433
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| UNII = 8G167061QZ
| UNII_Ref = {{fdacite|correct|FDA}}
| EINECS = 200-810-26
| DrugBank = DB00330
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| KEGG = D07925
| KEGG_Ref = {{keggcite|correct|kegg}}
| MeSHName = Ethambutol
| ChEBI = 4877
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 44884
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| SMILES = CC[C@@H](CO)NCCN[C@@H](CC)CO
Etambutol atau Ethambutol adalah antibiotik yang mencegah pertumbuhan bakteri [[tuberculous]] di dalam tubuh.<ref name="Obat"/> Ethambutol biasanya digunakan untuk mengobati [[tubercolosis]] (TB).<ref name="Obat"/> Penggunaan ethambutol secara berlebihan atau penggunaan jangka panjang dapat menyebabkan efek samping.<ref name="Obat">[http://www.informasiobat.com/ethambutol ethambutol]</ref>▼
| StdInChI = 1S/C10H24N2O2/c1-3-9(7-13)11-5-6-12-10(4-2)8-14/h9-14H,3-8H2,1-2H3/t9-,10-/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = AEUTYOVWOVBAKS-UWVGGRQHSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
}}
|Section2={{Chembox Properties
| C=10 | H=24 | N=2 | O=2
| Appearance = Kristal putih
| Odor = Tanpa bau
| LogP = −0.291
}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = J04
| ATCCode_suffix = AK02
| AdminRoutes = Oral
| Metabolism = Hepatis
| HalfLife = 3–4 jam
| ProteinBound = 20–30%
| Excretion = Renal
| Pregnancy_category = B{{where|date=April 2015}}
| Pregnancy_US =
| Pregnancy_AU =
| Pregnancy_US_comment =
}}
|Section8={{Chembox Related
| OtherCompounds = {{unbulleted list|[[ethylenediamine]]|[[TMEDA]]}}
}}
}}
▲'''Etambutol''' atau '''Ethambutol''' adalah [[antibiotik]] yang mencegah pertumbuhan bakteri [[
== Efek Samping ==
Efek
== Referensi ==
{{reflist}}
{{Authority control}}
[[Kategori:
[[Kategori:
[[Kategori:Amina sekunder]]
[[Kategori:Obat Esensial Organisasi Kesehatan Dunia]]
[[Kategori:Antituberkulosis]]
[[Kategori:Obat Esensial Nasional Indonesia]]
|