Asam folat: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler |
Perbaikan infobox |
||
Baris 1:
{{terjemah|Inggris}}
{{ |
| INN =
| type =<!-- empty -->
| IUPAC_name = asam (2''S'')-2-<nowiki>[[</nowiki>4-[(2-Amino-4-okso-1''H''-pteridin-6-il)metilamino]benzoil]amino]pentanadioat<ref>{{cite web|title=Folic Acid|url=https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6037|publisher=The PubChem Project|deadurl=no|archiveurl=https://web.archive.org/web/20140407091703/http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6037|archivedate=7 April 2014|df=dmy-all}}</ref>
| ImageName = Folic acid▼
| synonyms = FA, asam ''N''-(4-<nowiki/>{[(2-amino-4-okso-1,4-dihidropteridin-6-yl)metil]amino}benzoil)-<small>L</small>-glutamat, asam pteroil-L-glutamat, vitamin B<sub>9</sub>,<ref name="Folate 2011">{{cite journal|last1=Fenech|first1=Michael|title=Folate (vitamin B9) and vitamin B12 and their function in the maintenance of nuclear and mitochondrial genome integrity|journal=Mutation Research/Fundamental and Molecular Mechanisms of Mutagenesis|date=May 2012|volume=733|issue=1–2|pages=21–33|doi=10.1016/j.mrfmmm.2011.11.003|pmid=22093367}}</ref> vitamin B<sub>c</sub>,<ref name="Definition of vitamin Bc">{{cite web|url=http://medical-dictionary.thefreedictionary.com/vitamin+Bc |title=Definition of vitamin Bc|publisher=Medical-dictionary.thefreedictionary.com |accessdate=9 September 2012}}</ref> vitamin M,<ref name=darby1945>{{cite journal|last1=Darby|first1=William J.|last2=Jones|first2=Edgar|title=Treatment of Sprue with Synthetic L. casei Factor (Folic Acid, Vitamin M).|journal=Experimental Biology and Medicine|date=1 November 1945|volume=60|issue=2|pages=259–262|doi=10.3181/00379727-60-15154P|url=http://ebm.sagepub.com/content/60/2/259.short|accessdate=13 December 2014}}</ref> folacin, pteroyl-L-glutamate
| width = 260px
| alt = Skeletal formula
|PubChem=6037▼
| image2 = Folic acid crystals.jpg
|
| alt2 = Folic acid as a yellow-orange crystalline powder
<!-- Clinical data -->
| pronounce = fo lat
| tradename =
| Drugs.com = {{drugs.com|monograph|folic-acid}}
| MedlinePlus = a682591
| pregnancy_AU = <!-- A/B1/B2/B3/C/D/X -->
| pregnancy_AU_comment =
| pregnancy_US = A
| pregnancy_category=
| routes_of_administration = Oral, IM, IV, subkutan
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU_comment =
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_DE = <!-- Anlage I, II, III -->
| legal_NZ = <!-- Class A, B, C -->
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C -->
| legal_US = OTC
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV-->
| legal_status = <!-- Free text -->
<!-- Pharmacokinetic data -->
| bioavailability = 50–100%<ref name=AHFS2016/>
| protein_bound =
| metabolism = Hati<ref name=AHFS2016/>
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion = Urin<ref name=AHFS2016/>
<!-- Identifiers -->
| CAS_number = 59-30-3
| ATCvet =
| ATC_prefix = B03
| ATC_suffix = BB01
▲| PubChem = 6037
| DrugBank = DB00158
| KEGG = C00504
| SMILES = n1c2C(=O)NC(N)=Nc2ncc1CNc3ccc(cc3)C(=O)N[C@H](C(O)=O)CCC(O)=O
| StdInChI = 1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1
| StdInChIKey = OVBPIULPVIDEAO-LBPRGKRZSA-N
| ChEBI = 27470
| UNII = 935E97BOY8
| ChEMBL = 1622
| IUPHAR_ligand = 4563
| ChemSpiderID = 5815
| solubility = 1,6 mg/L (25 °C)
| melting_point = 250
|C=19
| H=19
| N=7
| O=6
| melting_notes = (dekomposisi)
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
<!-- Chemical data -->
| chemical_formula =
| molecular_weight =
}}
| |||