Melfalan: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
WanaraLima (bicara | kontrib) Tidak ada ringkasan suntingan |
||
Baris 1:
{{Short description|Chemical compound}}
{{Use dmy dates|date=September 2019}}
{{cs1 config |name-list-style=vanc |display-authors=6}}
{{Infobox drug
| Watchedfields = changed
| verifiedrevid = 462248349
| image = Melphalan.svg
| width = 240
| alt =
| image2 = Melphalan ball-and-stick.png
| alt2 =
<!-- Clinical data -->
| pronounce =
| tradename = Alkeran, Evomela, Phelinun, others
| Drugs.com = {{drugs.com|monograph|melphalan}}
| MedlinePlus = a682220
| DailyMedID = Melphalan
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU_comment =
| pregnancy_category =
| routes_of_administration = [[Oral administration|By mouth]], [[Intravenous therapy|intravenous]], [[intra-arterial]]
| class =
| ATCvet =
| ATC_prefix = L01
| ATC_suffix = AA03
| ATC_supplemental =
<!-- Legal status -->
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled -->
| legal_AU_comment =
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F -->
| legal_BR_comment =
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA_comment =
| legal_DE = <!-- Anlage I, II, III or Unscheduled -->
| legal_DE_comment =
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment =
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C -->
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment = <ref name="Alkeran FDA label">{{cite web | title=Alkeran- melphalan tablet, film coated | website=DailyMed | date=18 November 2019 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=ff913271-0090-4832-a0fe-5154fe8f97b9 | access-date=23 April 2022}}</ref><ref name="Evomela FDA label" /><ref name="Hepzato FDA label">https://www.accessdata.fda.gov/drugsatfda_docs/label/2023/201848s000lbl.pdf</ref>
| legal_EU = Rx-only
| legal_EU_comment = <ref name="Phelinun EPAR" />
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
| legal_UN_comment =
| legal_status = <!-- For countries not listed above -->
<!-- Pharmacokinetic data -->
| bioavailability = 25–89% (By mouth)
| protein_bound =
| metabolism = Hydrolysis to inactive metabolites
| metabolites =
| onset =
| elimination_half-life = 1.5 ± 0.8 hours
| duration_of_action =
| excretion = [[Kidney]] (IV: 5.8–21.3%)
<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 148-82-3
| CAS_supplemental =
| PubChem = 460612
| IUPHAR_ligand = 7620
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01042
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 405297
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q41OR9510P
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00369
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 28876
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 852
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = <small>(2''S'')-2-amino-3-<nowiki/>{4-[bis(2-chloroethyl)amino]phenyl}propanoic acid</small>
<!-- Chemical and physical data -->
| IUPAC_name = 4-[''bis''(2-Chloroethyl)amino]-<small>L</small>-phenylalanine
| C=13 | H=18 | Cl=2 | N=2 | O=2
| SMILES = c1cc(ccc1C[C@@H](C(=O)O)N)N(CCCl)CCCl
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H18Cl2N2O2/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19/h1-4,12H,5-9,16H2,(H,18,19)/t12-/m0/s1
| StdInChI_comment =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = SGDBTWWWUNNDEQ-LBPRGKRZSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
'''Melfalan''' adalah [[obat]] golongan agen antineoplastik [[sitotoksik]]. Melfalan bisa digunakan dalam tata laksana mieloma multipel seperti, [[kanker payudara]], karsinoma ovarium, polisitemia vera, adenokarsinoma ovarium lanjut, melanoma, sarkoma jaringan lunak, atau neuroblastoma.<ref>{{Cite web|title=Melphalan|url=https://go.drugbank.com/drugs/DB01042|website=go.drugbank.com|language=en|access-date=2023-10-26}}</ref>
| |||