Deksklorfeniramin: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
||
Baris 1:
{{Drugbox
| verifiedrevid = 443584459
| IUPAC_name = (3''S'')-3-(4-chlorophenyl)-''N'',''N''-dimetil-3-piridin-3-ilpropan-1-amin
| image = Dexchlorpheniramine.svg
| width = 200px
| drug_name = Deksklorfeniramin
<!--Clinical data-->
| tradename = Chlor-trimeton, Polaramine, dll
| Drugs.com = {{drugs.com|monograph|chlorpheniramine-maleate-tannate-dexchlorpheniramine-maleate}}
| MedlinePlus = a682543
| pregnancy_category =
| legal_AU = S3
| routes_of_administration = Oral, Intravena
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
<!--Identifiers-->
| IUPHAR_ligand = 1210
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 25523-97-1
| ATC_prefix = R06
| ATC_suffix = AB02
| PubChem = 33036
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01114
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 30576
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 3Q9Q0B929N
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07803
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 4464
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1201353
<!--Chemical data-->
| C=16 | H=19 | Cl=1 | N=2
| smiles = Clc1ccc(cc1)[C@@H](c2ncccc2)CCN(C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H19ClN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3/t15-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = SOYKEARSMXGVTM-HNNXBMFYSA-N
}}
'''Deksklorfeniramin''' adalah obat [[antihistamin]] dengan sifat [[antikolinergik]] yang digunakan untuk mengobati kondisi [[alergi]] seperti [[rinitis alergi]] atau [[urtikaria]].<ref name="pmid16390354">{{cite journal | vauthors = Theunissen EL, Vermeeren A, Ramaekers JG | title = Repeated-dose effects of mequitazine, cetirizine and dexchlorpheniramine on driving and psychomotor performance | journal = British Journal of Clinical Pharmacology | volume = 61 | issue = 1 | pages = 79–86 | date = January 2006 | pmid = 16390354 | pmc = 1884990 | doi = 10.1111/j.1365-2125.2005.02524.x }}</ref><ref name="pmid23680058">{{cite journal | vauthors = Ortíz San Román L, Sanavia Morán E, Campos Domínguez M, Peinador García MM | title = [Anticholinergic syndrome due to dexchlorpheniramine as a cause of urinary retention] | journal = Anales de Pediatria | volume = 79 | issue = 6 | pages = 400–401 | date = December 2013 | pmid = 23680058 | doi = 10.1016/j.anpedi.2013.02.014 }}</ref> Obat ini adalah isomer dekstrorotatori [[klorfenamin]] yang aktif secara [[farmakologi]]s. Obat ini mulai digunakan secara medis pada tahun 1959 dan dipatenkan pada tahun 1962.<ref name=Fis2006>{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=547 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA547 |language=en}}</ref>
| |||