Hidroksizin: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
k Muhammad Anas Sidik memindahkan halaman Hydroxyzine ke Hidroksizin: Judul salah eja Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
Tidak ada ringkasan suntingan Tag: halaman dengan galat kutipan kemungkinan perlu dirapikan Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
||
Baris 1:
{{Drugbox
| verifiedrevid = 461774177
| image = Hydroxyzine.svg
| width = 250
| alt =
| image2 = Hydroxyzine-3d-sticks.png
| width2 = 250
| alt2 =
<!--Clinical data-->
| pronounce = {{IPAc-en|h|aɪ|ˈ|d|r|ɒ|k|s|ᵻ|z|iː|n}}
| tradename = Atarax,<ref>{{cite web | title=Atarax: FDA-Approved Drugs | website=U.S. [[Food and Drug Administration]] (FDA) | url=https://www.accessdata.fda.gov/scripts/cder/daf/index.cfm?event=overview.process&ApplNo=010392 | access-date=25 March 2023}}</ref> Vistaril,<ref>{{cite web|title=Vistaril: FDA-Approved Drugs|url=https://www.accessdata.fda.gov/scripts/cder/daf/index.cfm?event=overview.process&ApplNo=011459|access-date=5 August 2020|website=U.S. [[Food and Drug Administration]] (FDA) }}</ref> others
| Drugs.com = {{drugs.com|monograph|hydroxyzine-hydrochloride}}
| MedlinePlus = a682866
| DailyMedID = Hydroxyzine
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU_comment =
| pregnancy_category =
| dependency_liability = None <ref name=Hub2001>{{cite book | vauthors = Hubbard JR, Martin PR |title=Substance Abuse in the Mentally and Physically Disabled |date=2001 |publisher=CRC Press |isbn=9780824744977 |page=26 |url=https://books.google.com/books?id=MY1kFYk98mQC&pg=PA26 }}</ref>
| routes_of_administration = [[Oral administration|By mouth]], [[intramuscular injection]]
| class = [[First generation antihistamine]]<ref name=Chem2020/>
| ATC_prefix = N05
| ATC_suffix = BB01
| ATC_supplemental = {{ATC|N05|BB51}}
| legal_AU = S4
| legal_CA = Rx-only
| legal_EU = Rx-only
| legal_UK = POM
| legal_US = Rx-only
| legal_status = Rx-only
<!--Pharmacokinetic data-->
| bioavailability = High
| protein_bound = 93%
| metabolism = [[Liver]]
| metabolites = [[Cetirizine]], others
| elimination_half-life = Adults: 20.0 hours<ref name="pmid2866055"/><ref name="pmid6141198" /><br />Elderly: 29.3 hours<ref name="pmid2562944" /><br />Children: 7.1 hours<ref name="pmid2866055" />
| excretion = [[Urine]], [[feces]]
<!--Identifiers-->
| index2_label = as HCl
<!-- | index3_label = as pamoate -->
| IUPHAR_ligand = 7199
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 68-88-2
| CAS_number2 = 2192-20-3
| CAS_supplemental = 10246-75-0 ([[pamoate]])
| PubChem = 3658
| PubChem2 = 91513
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00557
| DrugBank2 = DBSALT000343
<!-- | DrugBank3 = DBSALT000984 -->
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3531
| ChemSpiderID2 = 82634
<!-- | ChemSpiderID3 = 23443 -->
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 30S50YM8OG
| UNII2 = 76755771U3
<!-- | UNII3 = M20215MUFR -->
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08054
| KEGG2 = D00672
<!-- | KEGG3 = D01096 -->
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 5818
| ChEBI2 = 5819
<!-- | ChEBI3 = 31680 -->
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 896
| ChEMBL2 = 3186993
<!-- | ChEMBL3 = 1200467 -->
| synonyms = UCB-4492
<!--Chemical data-->
| IUPAC_name = (±)-2-(2-<nowiki/>{4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl}ethoxy)ethanol
| C = 21
| H = 27
| Cl = 1
| N = 2
| O = 2
| SMILES = Clc1ccc(cc1)C(c2ccccc2)N3CCN(CC3)CCOCCO
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H27ClN2O2/c22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25/h1-9,21,25H,10-17H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZQDWXGKKHFNSQK-UHFFFAOYSA-N
}}
'''Hidroksizin''' adalah obat antihistamin.[8] Obat ini digunakan untuk mengatasi rasa gatal, kecemasan, insomnia, dan mual (termasuk yang disebabkan oleh mabuk perjalanan).[8] Obat ini digunakan baik melalui mulut atau suntikan ke otot.[8]
Hidroksizin bekerja dengan cara menghalangi efek histamin.[9] Obat ini adalah antihistamin generasi pertama dalam keluarga bahan kimia piperazina.[8][4] Efek samping yang umum termasuk rasa kantuk, sakit kepala, dan mulut kering.[8][9] Efek samping yang serius mungkin termasuk perpanjangan QT.[9] Tidak jelas apakah penggunaan selama kehamilan atau menyusui aman.[8]
Obat ini pertama kali dibuat oleh Union Chimique Belge pada tahun 1956 dan disetujui untuk dijual oleh Pfizer di Amerika Serikat pada akhir tahun itu.[8][10] Pada tahun 2022, obat ini merupakan obat ke-46 yang paling sering diresepkan di Amerika Serikat, dengan lebih dari 13 juta resep.[11][12]
== Nama lain ==
| |||