Pravastatin: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
||
Baris 7:
<!-- Clinical data -->
| tradename = Pravachol,
| MedlinePlus = a692025
| DailyMedID = Pravastatin
| pregnancy_AU = D
| routes_of_administration = [[Oral
| ATC_prefix = C10
| ATC_suffix = AA03
Baris 30 ⟶ 29:
| bioavailability = 18%<ref name = PK>{{cite journal | vauthors = Neuvonen PJ, Backman JT, Niemi M | title = Pharmacokinetic comparison of the potential over-the-counter statins simvastatin, lovastatin, fluvastatin and pravastatin | journal = Clinical Pharmacokinetics | volume = 47 | issue = 7 | pages = 463–474 | date = 2008 | pmid = 18563955 | doi = 10.2165/00003088-200847070-00003 | s2cid = 11716425 }}</ref>
| protein_bound = 50%<ref name = PK/>
| metabolism = [[
| elimination_half-life = 1-3
<!-- Identifiers -->
Baris 59 ⟶ 58:
<!-- Chemical and physical data -->
| IUPAC_name = (3''R'',5''R'')-3,5-
| C=23 | H=36 | O=7
| smiles = O=C(O)C[C@H](O)C[C@H](O)CC[C@H]2[C@H](/C=C\C1=C\[C@@H](O)C[C@H](OC(=O)[C@@H](C)CC)[C@@H]12)C
| |||