Etravirin: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
←Membuat halaman berisi ''''Etravirin''' (disingkat '''ETR''',[3]) adalah obat antiretroviral yang digunakan untuk mengobati HIV.[1] Etravirine adalah penghambat transkriptase balik non-nukleosida (NNRTI) human immunodeficiency virus tipe 1 (HIV-1).[1] Tidak seperti agen dalam kelas tersebut, resistensi terhadap NNRTI lain tampaknya tidak menyebabkan resistensi terhadap etravirine.[4] Etravirine dipasarkan oleh Janssen, anak perusahaan Johnson & Johnson. Pada bulan Januari 2008, Badan Pe...' Tag: kemungkinan perlu dirapikan Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
||
Baris 1:
{{Infobox drug
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 443748530
| image = Etravirine structure.svg
| width = 150
| alt =
| image2 = Etravirine ball-and-stick model.png
| width2 = 185
| alt2 =
<!-- Clinical data -->
| pronounce =
| tradename = Intelence
| Drugs.com = {{drugs.com|monograph|etravirine}}
| MedlinePlus = a608016
| DailyMedID = Etravirine
| pregnancy_AU = B1
| pregnancy_AU_comment =
| pregnancy_category =
| routes_of_administration = [[By mouth]]
| class =
| ATC_prefix = J05
| ATC_suffix = AG04
| ATC_supplemental =
<!-- Legal status -->
| legal_AU = S4
| legal_AU_comment =
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F -->
| legal_BR_comment =
| legal_CA = Schedule VI
| legal_CA_comment =
| legal_DE = <!-- Anlage I, II, III or Unscheduled -->
| legal_DE_comment =
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment =
| legal_UK = POM
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment = <ref name="Intelence FDA label">{{cite web | title=Intelence- etravirine tablet | website=DailyMed | date=15 August 2023 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=6a9cbc29-9f15-4b24-8d86-206b82887f3d | access-date=14 August 2024}}</ref>
| legal_EU = Rx-only
| legal_EU_comment = <ref name="Intelence EPAR">{{cite web | title=Intelence EPAR | website=[[European Medicines Agency]] (EMA) | date=28 August 2008 | url=https://www.ema.europa.eu/en/medicines/human/EPAR/intelence | access-date=14 August 2024}} Text was copied from this source which is copyright European Medicines Agency. Reproduction is authorized provided the source is acknowledged.</ref>
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
| legal_UN_comment =
| legal_status = <!-- For countries not listed above -->
<!-- Pharmacokinetic data -->
| bioavailability =
| protein_bound = 99.9%
| metabolism = [[Liver]] ([[CYP3A4]], [[CYP2C9]] & [[CYP2C19]]-mediated)
| metabolites =
| onset =
| elimination_half-life = 41±20 hours
| duration_of_action =
| excretion = Faeces (93.7%), urine (1.2%)
<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 269055-15-4
| PubChem = 193962
| IUPHAR_ligand =
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB06414
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 168313
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0C50HW4FO1
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D04112
| ChEBI =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 308954
| NIAID_ChemDB = 105156
| PDB_ligand = 65B
| synonyms = TMC125
<!-- Chemical and physical data -->
| IUPAC_name = 4-[6-Amino-5-bromo-2-[(4-cyanophenyl)amino] pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile
| C=20 | H=15 | Br=1 | N=6 | O=1
| SMILES = N#Cc3cc(c(Oc1nc(nc(c1Br)N)Nc2ccc(C#N)cc2)c(c3)C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H15BrN6O/c1-11-7-14(10-23)8-12(2)17(11)28-19-16(21)18(24)26-20(27-19)25-15-5-3-13(9-22)4-6-15/h3-8H,1-2H3,(H3,24,25,26,27)
| StdInChI_comment =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PYGWGZALEOIKDF-UHFFFAOYSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
'''Etravirin''' (disingkat '''ETR''',<ref>{{cite web |publisher=[[Department of Health and Human Services]] |work=Guidelines for the Use of Antiretroviral Agents in HIV-1-Infected Adults and Adolescents |url=http://aidsinfo.nih.gov/guidelines/html/1/adult-and-adolescent-arv-guidelines/34/appendix-a--key-to-acronyms |archive-url=https://web.archive.org/web/20120831103819/http://www.aidsinfo.nih.gov/guidelines/html/1/adult-and-adolescent-arv-guidelines/34/appendix-a--key-to-acronyms |url-status=dead |archive-date=31 August 2012 |title=Appendix A: Key to Acronyms }}</ref>) adalah obat antiretroviral yang digunakan untuk mengobati HIV. Etravirine adalah penghambat transkriptase balik non-nukleosida (NNRTI) human immunodeficiency virus tipe 1 (HIV-1).<ref name="Intelence FDA label" /> Tidak seperti agen dalam kelas tersebut, resistensi terhadap NNRTI lain tampaknya tidak menyebabkan resistensi terhadap etravirine.<ref>{{cite journal | vauthors = Stellbrink HJ | title = Antiviral drugs in the treatment of AIDS: what is in the pipeline ? | journal = European Journal of Medical Research | volume = 12 | issue = 9 | pages = 483–495 | date = October 2007 | pmid = 17933730 }}</ref> Etravirine dipasarkan oleh Janssen, anak perusahaan Johnson & Johnson. Pada bulan Januari 2008, Badan Pengawas Obat dan Makanan AS (FDA) menyetujui penggunaannya untuk orang-orang dengan resistensi yang sudah ada terhadap obat lain, menjadikannya obat anti-HIV ke-30 yang disetujui di Amerika Serikat dan yang pertama disetujui pada tahun 2008.<ref>{{cite web |url=http://ap.google.com/article/ALeqM5iCFQR1SKu681KqBBwrXJg1B6q5PAD8U8MS3G0 |title=FDA Approves HIV Drug Etravirine |publisher=[[Associated Press]] |date=18 January 2008 }}{{dead link|date=November 2012|bot=Legobot}}</ref> Obat ini juga disetujui untuk digunakan di Kanada pada bulan April 2008.<ref>{{cite press release |title=First New NNRTI in Nearly a Decade to Benefit Canadians with HIV/AIDS |publisher=Janssen-Ortho Inc. |date=1 April 2008 |url=http://www.janssen-ortho.com/JOI/pdf_files/INTELENCE_Press_Release_E.pdf |access-date=9 July 2008 |url-status=dead |archive-url=https://web.archive.org/web/20101102080713/http://janssen-ortho.com/JOI/pdf_files/INTELENCE_Press_Release_E.pdf |archive-date=2 November 2010 }}</ref>
Etravirine dilisensikan di Amerika Serikat, Kanada, Israel, Rusia, Australia, Selandia Baru, dan Uni Eropa,<ref>{{cite web |url=http://www.tibotec.com/news/detail.jhtml?itemname=news_48 |publisher=Tibotec |title=Intelence receives marketing authorisation in the European Union for HIV combination therapy |access-date=29 August 2008 |url-status=dead |archive-url=https://web.archive.org/web/20110928020018/http://www.tibotec.com/news/detail.jhtml?itemname=news_48 |archive-date=28 September 2011 }}</ref> dan sedang dalam tinjauan regulasi di Swiss.<ref>{{cite web |url=http://www.aidsmap.com/en/news/46E8FC38-3BB8-4DDD-9FEC-D6BFD5DD69AA.asp |publisher=[[aidsmap]] |title=Etravirine (TMC125, ''Intelence'') granted accelerated approval in US |access-date=24 January 2008 |archive-url=https://web.archive.org/web/20100102225629/http://aidsmap.com/en/news/46E8FC38-3BB8-4DDD-9FEC-D6BFD5DD69AA.asp |archive-date=2 January 2010 |url-status=dead }}</ref>
| |||