Droperidol: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan Tag: BP2014 |
Tidak ada ringkasan suntingan Tag: BP2014 |
||
Baris 1:
{{drugbox
| UNII_Ref =
| UNII = O9U0F09D5X
| IUPAC_name = <nowiki>1-{1-[4-(4-fluorophenyl)-4-oxobutyl]-1,2,5,6-tetrahydropyridin-4-yl]-1,3-dihydro-2</nowiki>''H''-benzimidazol-2-one
| image = Droperidol.svg
| alt = Skeletal formula of droperidol
| image2 = Droperidol-3D-spacefill.png
| alt2 = Space-filling model of droperidol
| width = 240
| CAS_number = 548-73-2
| ATC_prefix = N05
| ATC_suffix = AD08
| ATC_supplemental =
| PubChem = 3168
| ChEMBL_Ref =
| ChEMBL = 1108
| DrugBank = DB00450
| KEGG = D00308
| smiles = Fc1ccc(cc1)C(=O)CCCN2CC=C(CC2)N3c4ccccc4NC3=O
| C=22 | H=22 | F=1 | N=3 | O=2
| molecular_weight = 379.428 g/mol
| bioavailability =
| protein_bound =
| metabolism = [[Hepatic]]| elimination_half-life = 2.3 hours
| pregnancy_category = C <small>([[US]])</small>
| legal_US = Rx-only
| routes_of_administration = [[Intravenous]], [[Intramuscular]]
}}
'''Droperidol''' adalah semacam obat penenang yang berasal dari obat ''Butyrophenon''.<ref name="a">{{id}} {{cite journal
|