Droperidol: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan Tag: BP2014 |
Tidak ada ringkasan suntingan Tag: BP2014 |
||
Baris 1:
{{drugbox
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = O9U0F09D5X
| IUPAC_name = <nowiki>1-{1-[4-(4-fluorophenyl)-4-oxobutyl]-1,2,5,6-tetrahydropyridin-4-yl]-1,3-dihydro-2</nowiki>''H''-benzimidazol-2-one
| image = Droperidol.svg
| alt = Skeletal formula of droperidol
| image2 = Droperidol-3D-spacefill.png
| alt2 = Space-filling model of droperidol
| width = 240
| CAS_number = 548-73-2
| ATC_prefix = N05
| ATC_suffix = AD08
| ATC_supplemental =
| PubChem = 3168
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1108
| DrugBank = DB00450
| KEGG = D00308
| smiles = Fc1ccc(cc1)C(=O)CCCN2CC=C(CC2)N3c4ccccc4NC3=O
| C=22 | H=22 | F=1 | N=3 | O=2
| molecular_weight = 379.428 g/mol
| bioavailability =
| protein_bound =
| metabolism = [[Hepatic]]| elimination_half-life = 2.3 hours
| pregnancy_category = C <small>([[US]])</small>
| legal_US = Rx-only
| routes_of_administration = [[Intravenous]], [[Intramuscular]]
}}
'''Droperidol''' adalah semacam obat penenang yang berasal dari obat ''Butyrophenon''.<ref name="a">{{id}} {{cite journal
| author = Shadily, Hasan
Baris 25 ⟶ 54:
| pages =
| doi =
| id = ISBN: 978-979-27-19130
| url =
| format =
| publisher = Jakarta: Elex Media Komputindo
Baris 54 ⟶ 83:
Dosis penggunaan droperidol adalah:
*Untuk mengetasi kegelisahan akut dapat digunakan i.m/i.v 5-10 mili gram. <ref name=b></ref>
*Untuk infark i.v perlahan 2.5 mili gram (bersama [[fentanyl]] 0,05 mili gram). <ref name=b></ref>
== Referensi ==
|