Inositol: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Aldnonymous (bicara | kontrib) k clean up, replaced: Rujukan → Referensi using AWB |
Penambahan Chembox |
||
Baris 1:
{{chembox
| Watchedfields = changed
| verifiedrevid = 464369619
| Name = ''myo''-Inositol
| Reference =<ref>''Merck Index'', 11th Edition, '''4883'''.</ref>
| ImageFile = Inositol structure.png
| ImageSize = 125px
| ImageName = ''myo''-Inositol
| ImageFile1 = Myo-inositol numbering.svg
| ImageSize1 = 160px
| ImageName1 = ''myo''-Inositol
| IUPACName = (1''R'',2''R'',3''S'',4''S'',5''R'',6''S'')-cyclohexane-1,2,3,4,5,6-hexol
| OtherNames =''cis''-1,2,3,5-''trans''-4,6-Cyclohexanehexol , Cyclohexanehexol,<br />Mouse antialopecia factor,<br />Nucite, Phaseomannite,<br />Phaseomannitol,<br />Rat antispectacled eye<br /> factor, and Scyllite<br />(for the structural<br />isomer ''scyllo''-Inositol)
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 4495
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10239179
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4L6452S749
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1222251
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08079
| InChI = 1/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4+,5-,6-
| InChIKey = CDAISMWEOUEBRE-GPIVLXJGBG
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4+,5-,6-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CDAISMWEOUEBRE-GPIVLXJGSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 87-89-8
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17268
| SMILES = [C@@H]1([C@@H]([C@@H]([C@@H]([C@H]([C@@H]1O)O)O)O)O)O
| PubChem = 892
}}
|Section2={{Chembox Properties
| C=6 | H=12 | O=6
| MolarMass = 180,16 g/mol
| Density = 1,752 g/cm<sup>3</sup>
| MeltingPt = 225 hingga 227 °C
| MeltingPt_notes =
}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = A11
| ATCCode_suffix = HA07
}}
|Section7={{Chembox Hazards
| NFPA-H = 1
| NFPA-F = 0
| NFPA-R = 0
| FlashPt = 143 °C
}}
}}
'''Inositol''' adalah komponen utama [[membran sel]] yang berikatan dengan molekul [[fosfatidilkolin]].<ref name="Winarto."/>
| |||