Rabeprazol: Perbedaan antara revisi

Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan
infobox
Baris 1:
{{inuse}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 462080585
| drug_name =
| INN =
| type = <!-- empty -->
| image = rabeprazole.svg
| width = 240
| alt =
| image2 = rabeprazole3d.png
| width2 = 240
| alt2 =
| chirality = [[Racemic mixture]]<ref name="Marelli Review 2012" />
| caption =
 
<!-- Clinical data -->
| pronounce = {{IPAc-en|r|ə|ˈ|b|ɛ|p|r|ə|ˌ|z|ɔː|l}}
| tradename = Pariet
| Drugs.com = {{drugs.com|monograf|rabeprazole-sodium}}
| MedlinePlus = a699060
| licence_CA =
| licence_EU =
| DailyMedID = Rabeprazol
| licence_US = Rabeprazol
| pregnancy_AU = B1
| pregnancy_US = N
| pregnancy_category=
| dependency_liability =
| addiction_liability =
| routes_of_administration = Obat oral
| class = [[Proton pump inhibitor]]<ref name="Marelli Review 2012" />
| ATCvet =
| ATC_prefix = A02
| ATC_suffix = BC04
| ATC_supplemental = {{ATC|A02|BC54}} {{ATC|A02|BD12}} {{ATC|A02|BD13}}
 
<!-- Legal status -->
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US =
| legal_US_comment =
| legal_UN =
| legal_UN_comment =
| legal_status =
 
<!-- Pharmacokinetic data -->
| bioavailability = 52%
| protein_bound = 96.3%<ref name="Langtry Review">{{cite journal|last1=Langtry|first1=HD|last2=Markham|first2=A|title=Rabeprazole: a review of its use in acid-related gastrointestinal disorders.|journal=Drugs|date=October 1999|volume=58|issue=4|pages=725–42|pmid=10551440|doi=10.2165/00003495-199958040-00014}}</ref>
| metabolism = CYP2C19 dan CYP3A4 di hati
| metabolites = thioether carboyxlic acid metabolite, thioether glucuronide metabolite, sulfone metabolite<ref name="Langtry Review" />
| onset =
| elimination_half-life = 1 jam
| duration_of_action =
| excretion = 90% melalui [[ginjal]] sebagai metabolit<ref name="PubChem">{{cite web|title=Rabeprazole|url=https://pubchem.ncbi.nlm.nih.gov/compound/rabeprazole#section=Absorption-Distribution-and-Excretion&fullscreen=true |website=PubChem|publisher=NCBI|accessdate=10 January 2020}}</ref><ref>{{cite web | author=PubChem | title=Rabeprazole | website=PubChem | url=https://pubchem.ncbi.nlm.nih.gov/compound/5029 | access-date=10 January 2020}}</ref>
 
<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 117976-89-3
| CAS_supplemental =
| PubChem = 5029
| PubChemSubstance =
| IUPHAR_ligand = 7290
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01129
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4853
| UNII_Ref =
| UNII = 32828355LL
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08463
| KEGG2_Ref = {{keggcite|correct|kegg}}
| KEGG2 = C07864
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 8768
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1219
| NIAID_ChemDB =
| PDB_ligand = RZX
| synonyms =
 
<!-- Chemical and physical data -->
| IUPAC_name = (''RS'')-2-([4-(3-Metoksipropoksi)-3-metilpiridin-2-yl]metilsulfinil)-1''H''-benzo[''d'']imidazol
| chemical_formula =
| C=18 | H=21 | N=3 | O=3 | S=1
| molecular_weight =
| SMILES = CC1=C(C=CN=C1CS(=O)C2=NC3=CC=CC=C3N2)OCCCOC
| Jmol =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H21N3O3S/c1-13-16(19-9-8-17(13)24-11-5-10-23-2)12-25(22)18-20-14-6-3-4-7-15(14)21-18/h3-4,6-9H,5,10-12H2,1-2H3,(H,20,21)
| StdInChI_comment =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YREYEVIYCVEVJK-UHFFFAOYSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
'''Rabeprazol''' merupakan obat golongan PPI yang digunakan pada penanganan gejala GERD dan peningkatan produksi asam lambung.<ref>{{Cite web|url=https://medlineplus.gov/druginfo/meds/a699060.html|title=Rabeprazole: MedlinePlus Drug Information|website=medlineplus.gov|language=en|access-date=2019-11-13}}</ref>