Omeprazol: Perbedaan antara revisi

Konten dihapus Konten ditambahkan
k Reverted to revision 17301627 by Rachmat04 (talk)
Tag: Pembatalan
InternetArchiveBot (bicara | kontrib)
Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.8
Baris 49:
| molecular_weight = 345.42 g/mol
| smiles = Cc1c(OC)c(C)cnc1CS(=O)c2nc3ccc(OC)cc3n2
| bioavailability= 35–76%<ref>[http://www1.astrazeneca-us.com/pi/Prilosec.pdf Prilosec Prescribing Information] {{Webarchive|url=https://web.archive.org/web/20100216022020/http://www1.astrazeneca-us.com/pi/Prilosec.pdf |date=2010-02-16 }}. AstraZeneca Pharmaceuticals.</ref><ref>{{cite journal| last1 = Vaz-Da-Silva | first1 = M| last2 = Loureiro | first2 = AI| last3 = Nunes | first3 = T| last4 = Maia | first4 = J| last5 = Tavares | first5 = S| last6 = Falcão | first6 = A| last7 = Silveira | first7 = P| last8 = Almeida | first8 = L| last9 = Soares-Da-Silva | first9 = P| title = Bioavailability and bioequivalence of two enteric-coated formulations of omeprazole in fasting and fed conditions| journal = Clinical Drug Investigation| volume = 25| issue = 6| pages = 391–9| year = 2005| pmid = 17532679| url = http://www.medscape.com/viewarticle/508018| doi = 10.2165/00044011-200525060-00004}}</ref>
| protein_bound = 95%
| metabolism = [[Liver|Hepatic]] ([[CYP2C19]], [[CYP3A4]])