Asam oleat: Perbedaan antara revisi

Konten dihapus Konten ditambahkan
HsfBot (bicara | kontrib)
k Bot: +{{Authority control}}
top: infobox
Baris 1:
{{chembox
|Verifiedfields=changed
|Watchedfields=changed
|verifiedrevid=416953907
|Name=Asam oleat
|ImageFile=Oleic-acid-skeletal.svg
|ImageSize=250px
|ImageFile2=Oleic-acid-3D-vdW.png
|ImageSize2=250px
|ImageName=Asam oleat
|PIN=(9''Z'')-Octadec-9-enoic acid <!-- Nomenclature of Organic Chemistry – IUPAC Recommendations and Preferred Names 2013 (Blue Book) -->
|SystematicName=
|OtherNames=18:1 cis-9
|IUPACName=
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 1054
| SMILES = CCCCCCCC\C=C/CCCCCCCC(O)=O
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 445639
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 8659
| CASNo = 112-80-1
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2UMI9U37CP
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 393217
| DrugBank = DB04224
| InChI = 1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9-
| InChIKey = ZQPPMHVWECSIRJ-KTKRTIGZBB
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9-
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = ZQPPMHVWECSIRJ-KTKRTIGZSA-N
| RTECS =
}}
|Section2={{Chembox Properties
| C=18|H=34|O=2
| Appearance = cairan berminyak tidak berwarna dengan bau seperti lemak babi
| Density = 0,895 g/mL
| Solubility = Tak larut
| SolubleOther = Larut
| Solvent = [[Ethanol]]
| MeltingPtC = 13 to 14
| BoilingPtC = 360
| BoilingPt_ref = <ref>{{Cite journal |last=Young |first=Jay A. |year=2002 |title=Chemical Laboratory Information Profile: Oleic Acid |journal=Journal of Chemical Education |volume=79 |issue=1 |pages=24 |bibcode=2002JChEd..79...24Y |doi=10.1021/ed079p24}}</ref>
| pKa =
| pKb =
| Viscosity =
| MagSus = -208,5·10<sup>−6</sup> cm<sup>3</sup>/mol
}}
|Section3={{Chembox Structure
| MolShape =
| Coordination =
| CrystalStruct =
| Dipole =
}}
|Section7={{Chembox Hazards
| ExternalSDS = [http://hazard.com/msds/mf/baker/baker/files/o3596.htm JT Baker]
| MainHazards =
| FlashPt =
| NFPA-H = 0
| NFPA-F = 1
| NFPA-R = 0
}}
|Section8={{Chembox Related
| OtherAnions =
| OtherCations =
| OtherCompounds = [[Asam elaidat]]
}}
}}
'''Asam oleat''' atau asam ''Z''-Δ9-oktadekenoat merupakan [[asam lemak]] [[asam lemak tak jenuh|tak jenuh]] yang banyak dikandung dalam minyak [[zaitun]]. Selain minyak zaitun juga terdapat pada limbah industri sawit, yaitu lumpur sawit<ref>[http://repository.ipb.ac.id/handle/123456789/7663][Berbagai Usaha Memintas Rumenkan Asam Lemak Tak Jenuh]</ref> Asam ini tersusun dari 18 atom C dengan satu ikatan rangkap di antara atom C ke-9 dan ke-10. Selain dalam minyak zaitun (55-80%), asam lemak ini juga terkandung dalam minyak [[bunga matahari]] kultivar tertentu, minyak [[raps]], serta minyak biji anggur.