Ramipril: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
||
Baris 1:
{{Short description|ACE inhibitor medication}}
{{Use dmy dates|date=April 2020}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 464379985
| image = Ramipril structure.svg
| alt =
<!--Clinical data-->
| tradename = Altace, dll
| Drugs.com = {{drugs.com|monograph|ramipril}}
| MedlinePlus = a692027
| DailyMedID = Ramipril
| pregnancy_category =
| routes_of_administration = [[Oral]]
| legal_CA = Rx only
| legal_CA_comment =
| legal_UK = POM
| legal_US = Rx only
<!--Pharmacokinetic data-->
| bioavailability = 28%
| protein_bound = 73% (ramipril)<br />56% (ramiprilat)
| metabolism = [[Hati]] menuju ramiprilat
| elimination_half-life = 13 – 17 jam
| excretion = [[Ginjal]] (60%) & feses (40%)
<!--Identifiers-->
| IUPHAR_ligand = 6339
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 87333-19-5
| ATC_prefix = C09
| ATC_suffix = AA05
| PubChem = 5362129
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00178
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4514937
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = L35JN3I7SJ
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00421
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 8774
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1168
<!--Chemical data-->
| IUPAC_name = (2''S'',3a''S'',6a''S'')-1-[(2''S'')-2-[<nowiki />[(2''S'')-1-Etoksi-1-okso-4-fenilbutan-2-il]amino]propanoil]-3,3a,4,5,6,6a-heksahidro-2''H''-siklopenta[''b'']pirola-2-asam karboksilat
| C=23 | H=32 | N=2 | O=5
| smiles = O=C(OCC)[C@@H](N[C@H](C(=O)N1[C@H](C(=O)O)C[C@@H]2CCC[C@H]12)C)CCc3ccccc3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C23H32N2O5/c1-3-30-23(29)18(13-12-16-8-5-4-6-9-16)24-15(2)21(26)25-19-11-7-10-17(19)14-20(25)22(27)28/h4-6,8-9,15,17-20,24H,3,7,10-14H2,1-2H3,(H,27,28)/t15-,17-,18-,19-,20-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HDACQVRGBOVJII-JBDAPHQKSA-N
| melting_point = 109
}}
'''Ramipril''' merupakan obat jenis [[inhibitor ACE]] yang digunakan untuk mengobati [[tekanan darah tinggi]], [[gagal jantung]], dan penyakit ginjal diabetik.<ref name=AHFS2019/> Obat ini juga dapat digunakan sebagai obat pencegahan pada pasien berusia di atas 55 tahun untuk mengurangi risiko serangan jantung, stroke, atau kematian kardiovaskular pada pasien yang terbukti berisiko tinggi, seperti beberapa penderita diabetes dan pasien dengan penyakit pembuluh darah.<ref>{{cite journal | vauthors = Yusuf S, Sleight P, Pogue J, Bosch J, Davies R, Dagenais G | title = Effects of an angiotensin-converting-enzyme inhibitor, ramipril, on cardiovascular events in high-risk patients | journal = The New England Journal of Medicine | volume = 342 | issue = 3 | pages = 145–53 | date = January 2000 | pmid = 10639539 | doi = 10.1056/NEJM200001203420301 | doi-access = free }}</ref><ref>{{Cite journal|date=January 2000|title=Effects of ramipril on cardiovascular and microvascular outcomes in people with diabetes mellitus: results of the HOPE study and MICRO-HOPE substudy|author=HOPE study investigators|url=https://linkinghub.elsevier.com/retrieve/pii/S0140673699123237|journal=The Lancet|volume=355|issue=9200|pages=253–259|doi=10.1016/S0140-6736(99)12323-7|s2cid=1863533}}</ref><ref>{{cite journal | vauthors = Savarese G, Costanzo P, Cleland JG, Vassallo E, Ruggiero D, Rosano G, Perrone-Filardi P | title = A meta-analysis reporting effects of angiotensin-converting enzyme inhibitors and angiotensin receptor blockers in patients without heart failure | journal = Journal of the American College of Cardiology | volume = 61 | issue = 2 | pages = 131–42 | date = January 2013 | pmid = 23219304 | doi = 10.1016/j.jacc.2012.10.011 | doi-access = free }}</ref> Obat ini adalah obat awal yang masuk akal untuk tekanan darah tinggi. Obat ini digunakan secara oral.<ref name=AHFS2019/>
| |||