Bromfeniramin: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
||
Baris 1:
{{Short description|Chemical compound}}
{{Use dmy dates|date=March 2024}}
{{Drugbox| Watchedfields = changed
| verifiedrevid = 459984520
| image = Brompheniramine structure.svg
| width = 222
| alt =
<!-- Clinical data -->
| tradename = Bromfed, Dimetapp, Bromfenex, dll
| Drugs.com = {{drugs.com|monograph|brompheniramine-maleate-dexbrompheniramine-maleate}}
| MedlinePlus = a682545
| routes_of_administration = [[Oral (rute pemberian obat)|Oral]]
| legal_AU = S4 / S3 / S2
| legal_AU_comment =
| legal_US = Rx-only / OTC
<!-- Pharmacokinetic data -->
| bioavailability =
| metabolism = [[Hati]]
| elimination_half-life = 24.9 ± 9.3 jam<ref name="pmid6128358">{{cite journal |vauthors=Simons FE, Frith EM, Simons KJ | title = The pharmacokinetics and antihistaminic effects of brompheniramine | journal = The Journal of Allergy and Clinical Immunology | volume = 70 | issue = 6 | pages = 458–64 |date=December 1982 | pmid = 6128358 | doi = 10.1016/0091-6749(82)90009-4| doi-access = free }}</ref>
| excretion = [[Ginjal]]
<!-- Identifiers -->
| IUPHAR_ligand = 7133
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 86-22-6
| ATC_prefix = R06
| ATC_suffix = AB01
| PubChem = 6834
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00835
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 6573
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = H57G17P2FN
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07543
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 3183
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 811
<!-- Chemical data -->
| IUPAC_name = (''R''/''S'')-3-(4-Bromofenil)-''N'',''N''-dimetil-3-piridin-2-il-propan-1-amina
| C = 16 | H = 19 | Br = 1 | N = 2
| smiles = Brc1ccc(cc1)C(c2ncccc2)CCN(C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H19BrN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZDIGNSYAACHWNL-UHFFFAOYSA-N
}}
'''Bromfeniramin''' merupakan obat [[antihistamin]] generasi pertama golongan propilamin (alkilamin). Obat ini digunakan untuk pengobatan gejala [[pilek]] dan [[rinitis alergi]], seperti [[hidung berair]], mata gatal, mata berair, dan [[bersin]]. Seperti halnya obat antihistamin generasi pertama lainnya, obat ini dianggap sebagai antihistamin yang menenangkan.<ref name="Martindale34">{{Cite book| veditors = Sweetman SC |title=Martindale: the complete drug reference |edition=34th |publisher=Pharmaceutical Press |location=London |year=2005 |isbn=0-85369-550-4 |oclc=56903116 |page=569–70}}</ref>
|