Noretisteron: Perbedaan antara revisi

Konten dihapus Konten ditambahkan
Muhammad Anas Sidik (bicara | kontrib)
Tidak ada ringkasan suntingan
Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan
Muhammad Anas Sidik (bicara | kontrib)
Tidak ada ringkasan suntingan
Tag: halaman dengan galat kutipan Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan
Baris 1:
{{Drugbox
| Watchedfields = verified
| verifiedrevid = 462262921
| image = Norethisterone.svg
| width = 225
| image2 = Norethisterone molecule ball.png
| width2 = 235
 
<!--Clinical data-->
| tradename = Banyak
| Drugs.com = {{drugs.com|monograph|norethindrone}}
| MedlinePlus = a604034
| DailyMedID = Norethindrone
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_category =
| routes_of_administration = Oral, intramuskular (sebagai noretisteron enantat)
| class = [[Progestogen (medication)]]; [[Progestin]]
 
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
| legal_UK = <!-- GSL / P / POM / CD -->
| legal_US = Rx-only
| legal_status =
 
<!--Pharmacokinetic data-->
| bioavailability = 47–73% (rata-rata 64%)<ref name="pmid12215716">{{cite journal | vauthors = Stanczyk FZ | title = Pharmacokinetics and potency of progestins used for hormone replacement therapy and contraception | journal = Reviews in Endocrine & Metabolic Disorders | volume = 3 | issue = 3 | pages = 211–24 | date = September 2002 | pmid = 12215716 | doi = 10.1023/A:1020072325818 | s2cid = 27018468 }}</ref><ref name="pmid8842581">{{cite journal | vauthors = Fotherby K | title = Bioavailability of orally administered sex steroids used in oral contraception and hormone replacement therapy | journal = Contraception | volume = 54 | issue = 2 | pages = 59–69 | date = August 1996 | pmid = 8842581 | doi = 10.1016/0010-7824(96)00136-9 }}</ref>
| protein_bound = 97%:<ref name="pmid16112947" /><br />Albumin serum manusia: 61%;<ref name="pmid16112947" /><br />globulin pengikat hormon seks: 36%<ref name="pmid16112947" />
| metabolism = Terutama [[CYP3A4]] ([[Hati]]);<ref name="pmid18356043" /> juga [[5α-reduktase|5α-]]/[[5β-reduktase]], {{abbrlink|3α-|3α-hydroxysteroid dehydrogenase}}/{{abbrlink|3β-HSD|3β-hydroxysteroid dehydrogenase}}, & [[aromatase]]
| elimination_half-life = 5.2–12.8 jam (rata-rata 8.0 jam)<ref name="pmid12215716" />
| excretion =
 
<!--Identifiers-->
| IUPHAR_ligand = 2880
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 68-22-4
| ATC_prefix = G03
| ATC_suffix = AC01
| ATC_supplemental = {{ATC|G03|DC02}}
| PubChem = 6230
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00717
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5994
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = T18F433X4S
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00182
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 7627
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1162
| synonyms = NET; Noretindron; NSC-9564; LG-202; Etinilnortestosteron; Norpregneninolon; Anhidrohidroksi-norprogesteron; Etinilestrenolon; 17α-Etinil-19-nortestosteron; 17α-Etinilestra-4-en-17β-ol-3-ona; 17α-Hidroksi-19-norpregn-4-en-20-in-3-ona
 
<!--Chemical data-->
| IUPAC_name = (8''R'',9''S'',10''R'',13''S'',14''S'',17''R'')-17-etinil-17-hidroksi-13-metil-1,2,6,7,8,9,10,11,12,14,15,16-dodekahidrosiklopenta[''a'']fenantren-3-ona
| C=20 | H=26 | O=2
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C#C)O)CCC4=CC(=O)CC[C@H]34
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H26O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h1,12,15-18,22H,4-11H2,2H3/t15-,16+,17+,18-,19-,20-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VIKNJXKGJWUCNN-XGXHKTLJSA-N
| melting_point = 203
| melting_high = 204
}}
 
Norethisterone, juga dikenal sebagai norethindrone dan dijual dengan banyak merek, adalah obat progestin yang digunakan dalam pil KB, terapi hormon menopause, dan untuk pengobatan gangguan ginekologi. Obat ini tersedia dalam formulasi dosis rendah dan dosis tinggi, baik sendiri maupun dalam kombinasi dengan estrogen.[5][6] Ini digunakan melalui mulut atau, sebagai norethisterone enanthate, dengan suntikan ke otot.