Duloksetin: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
||
Baris 1:
{{Infobox drug
| Verifiedfields = changed
| verifiedrevid = 460765928
| image = Duloxetine.svg
| alt =
| image2 = Duloxetine-hydrochloride-from-xtal-3D-bs-17.png
| alt2 =
<!--Clinical data-->
| tradename = Cymbalta, Ariclaim, Yentreve, others<ref name="Drugs.com-Duloxetine-Generics"/>
| Drugs.com = {{drugs.com|monograph|duloxetine}}
| MedlinePlus = a604030
| DailyMedID = Duloxetine
| pregnancy_AU = B3
| routes_of_administration = [[Oral administration|By mouth]]
| class = [[Serotonin–norepinephrine reuptake inhibitor]]
| ATC_prefix = N06
| ATC_suffix = AX21
| legal_AU = S4
| legal_BR = C1
| legal_BR_comment = <ref name="Diário Oficial da União-2023">{{cite web |author-link=Brazilian Health Regulatory Agency |date=31 March 2023 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=3 August 2023 |access-date=16 August 2023 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=4 April 2023}}</ref>
| legal_CA = Rx-only
| legal_UK = POM
| legal_US = Rx-only
| legal_US_comment = <ref name="DailyMed-2020" />
| legal_EU = Rx-only
| legal_EU_comment = <ref name="European Medicines Agency (EMA)-2018" /><ref name="EMA-2018-EPAR" />
<!--Pharmacokinetic data-->
| bioavailability = ~ 50% (32% to 80%)
| protein_bound = ~ 95%
| metabolism = [[Liver]], two P450 isozymes, [[CYP2D6]] and [[CYP1A2]]
| elimination_half-life = 12 hours
| excretion = 70% in urine, 20% in feces
<!--Identifiers-->
| index2_label = as HCl
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 116539-59-4
| CAS_number2_Ref = {{cascite|correct|CAS}}
| CAS_number2 = 136434-34-9
| PubChem = 60835
| IUPHAR_ligand = 202
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00476
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 54822
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = O5TNM5N07U
| UNII2_Ref = {{fdacite|correct|FDA}}
| UNII2 = 9044SC542W
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07880
| KEGG2_Ref = {{keggcite|correct|kegg}}
| KEGG2 = D01179
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 36795
| ChEBI2_Ref = {{ebicite|correct|EBI}}
| ChEBI2 = 31526
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1175
| ChEMBL2_Ref = {{ebicite|correct|EBI}}
| ChEMBL2 = 1200328
| PDB_ligand = 29E
<!--Chemical data-->
| IUPAC_name = (+)-(''S'')-''N''-Methyl-3-(naphthalen-1-yloxy)-3-(thiophen-2-yl)propan-1-amine
| C=18 | H=19 | N=1 | O=1 | S=1
| smiles = CNCC[C@@H](C1=CC=CS1)OC2=CC=CC3=CC=CC=C32
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H19NOS/c1-19-12-11-17(18-10-5-13-21-18)20-16-9-4-7-14-6-2-3-8-15(14)16/h2-10,13,17,19H,11-12H2,1H3/t17-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZEUITGRIYCTCEM-KRWDZBQOSA-N
}}
'''Duloksetin''' adalah obat yang digunakan untuk mengatasi [[gangguan depresi mayor]], [[Gangguan kecemasan menyeluruh|gangguan kecemasan umum]], [[fibromyalgia]], dan nyeri neuropatik . <ref name="AHFS2018">{{Cite web|title=Duloxetine|url=https://www.drugs.com/monograph/duloxetine.html|website=Monograph|publisher=The American Society of Health-System Pharmacists|archive-url=https://web.archive.org/web/20181126162525/https://www.drugs.com/monograph/duloxetine.html|archive-date=2018-11-26|access-date=2018-12-24|url-status=live}}</ref> Rute pemberian obat digunakan melalui oral. <ref name="AHFS2018" />
|