Ksantotoksin: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
|||
Baris 1:
{{Drugbox
| verifiedrevid = 462250014
| image = Methoxsalen.svg
| alt = <!-- Clinical data -->
| pronounce =
| tradename = Oxsoralen, Uvadex, 8-mop, dll
| Drugs.com = {{drugs.com|CDI|methoxsalen}}
| MedlinePlus =
| DailyMedID = Methoxsalen
| pregnancy_AU = D
| pregnancy_AU_comment = <ref name="Uvadex APM summary">{{cite web | title=Uvadex | website=[[Therapeutic Goods Administration]] (TGA) | date=13 December 2019 | url=https://www.tga.gov.au/resources/auspmd/uvadex | access-date=25 August 2020}}</ref><ref name="AusPAR: Methoxsalen">{{cite web | title=AusPAR: Methoxsalen | website=Therapeutic Goods Administration (TGA) | date=12 December 2019 | url=https://www.tga.gov.au/auspar/auspar-methoxsalen | access-date=17 September 2021}}</ref>
| pregnancy_category =
| routes_of_administration = Ekstrakorporeal, oral
| class =
| ATC_prefix = D05
| ATC_suffix = AD02
| ATC_supplemental = {{ATC|D05|BA02}}
<!-- Legal status -->| legal_AU = S4
| legal_AU_comment = <ref name="Uvadex APM summary" /><ref name="AusPAR: Methoxsalen" />
'''Xantotoksin''': merupakan senyawa [[kimia]] C12H8O4, suatu lakton kristalin yang diperoleh dari tumbuhan ''Xanthoxylum senegalense''. Xantotoksin bersama sinar ultra violet digunakan untuk menyembuhkan [[penyakit]] balak (vitiligo) karena hilangnya [[pigmen]] kulit.▼
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F -->
| legal_BR_comment =
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA_comment =
| legal_DE = <!-- Anlage I, II, III or Unscheduled -->
| legal_DE_comment =
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment =
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C -->
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment = <ref name="Uvadex FDA label">{{cite web | title=Uvadex- methoxsalen injection, solution | website=DailyMed | publisher = U.S. National Library of Medicine | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=5ad333bd-845f-43f8-9ecf-43491f26c7c7 | access-date=17 September 2021 }}</ref><ref>{{cite web | title=Oxsoralen-Ultra- methoxsalen capsule, liquid filled | website=DailyMed | publisher = U.S. National Library of Medicine | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=ae951dc4-9031-43bf-943c-cb2366951f23 | access-date=17 September 2021}}</ref>
| legal_EU =
| legal_EU_comment =
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
| legal_UN_comment =
| legal_status = <!-- For countries not listed above -->
<!-- Pharmacokinetic data -->| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life = ~2 jam
| duration_of_action =
| excretion = <!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 298-81-7
| PubChem = 4114
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00553
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3971
| NIAID_ChemDB = 001590
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = U4VJ29L7BQ
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00139
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 18358
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 416
| synonyms = metoksalen
<!-- Chemical and physical data -->| IUPAC_name = 9-metoksi-7''H''-furo[3,2-''g''][1]benzopiran-7-ona
| C = 12
| H = 8
| O = 4
| smiles = COc1c2c(ccc(=O)o2)cc3c1occ3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H8O4/c1-14-12-10-8(4-5-15-10)6-7-2-3-9(13)16-11(7)12/h2-6H,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QXKHYNVANLEOEG-UHFFFAOYSA-N
}}
▲'''
==Referensi==
{{Reflist}}
[[Kategori:Kimia]]
{{Farmasi-stub}}
{{kimia-stub}}
| |||