Etinodiol: Perbedaan antara revisi

Konten dihapus Konten ditambahkan
Muhammad Anas Sidik (bicara | kontrib)
←Membuat halaman berisi ''''Etinodiol''' adalah progestin steroid dari kelompok 19-nortestosteron yang tidak pernah dipasarkan.[1][2][3] Turunan diasililasi, etynodiol diacetate, digunakan sebagai kontrasepsi hormonal.[1][2] Etynodiol terkadang digunakan sebagai sinonim untuk etynodiol diacetate. Obat ini dipatenkan pada tahun 1955.'
Tag: kemungkinan perlu dirapikan tanpa kategori [ * ] Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan
 
Muhammad Anas Sidik (bicara | kontrib)
Tidak ada ringkasan suntingan
Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan
Baris 1:
{{Drugbox
'''Etinodiol''' adalah progestin steroid dari kelompok 19-nortestosteron yang tidak pernah dipasarkan.[1][2][3] Turunan diasililasi, etynodiol diacetate, digunakan sebagai kontrasepsi hormonal.[1][2] Etynodiol terkadang digunakan sebagai sinonim untuk etynodiol diacetate. Obat ini dipatenkan pada tahun 1955.
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = (3''S'',8''R'',9''S'',10''R'',13''S'',14''S'',17''R'')-17-ethynyl-13-methyl-2,3,6,7,8,9,10,11,12,14,15,16-dodecahydro-1''H''-cyclopenta[''a'']phenanthrene-3,17-diol
| image = Etynodiol.svg
| width = 225px
 
<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| class = [[Progestin]]; [[Progestogen]]
 
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
 
<!-- Identifiers -->
| CAS_number_Ref =
| CAS_number = 1231-93-2
| CAS_supplemental =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9E01C36A9S
| ATC_prefix = G03
| ATC_suffix = DC06
| ATC_supplemental =
| PubChem =
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 14017
| KEGG =
| ChEBI =
| ChEMBL =
| synonyms = Ethynodiol; 3β-Hydroxynorethisterone; 17α-Ethynylestr-4-ene-3β,17β-diol
 
<!--Chemical data-->
| C=20 | H=28 | O=2
| SMILES = O[C@@H]4/C=C3\[C@@H]([C@H]2CC[C@]1([C@@H](CC[C@]1(C#C)O)[C@@H]2CC3)C)CC4
| StdInChI_Ref =
| StdInChI = 1S/C20H28O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h1,12,14-18,21-22H,4-11H2,2H3/t14-,15-,16+,17+,18-,19-,20-/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = JYILPERKVHXLNF-QMNUTNMBSA-N
}}
 
'''Etinodiol''' adalah progestin steroid dari kelompok 19-nortestosteron yang tidak pernah dipasarkan.<ref name="Macdonald1997">{{cite book | vauthors = Macdonald F | title = Dictionary of Pharmacological Agents | url = https://books.google.com/books?id=A0THacd46ZsC&pg=PA1454 | access-date = 12 May 2012 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 1454}}</ref><ref name="IndexNominum2000">{{cite book | title = Index Nominum 2000: International Drug Directory | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA422 | access-date = 30 May 2012 | year = 2000 | publisher = Taylor & Francis US | isbn = 978-3-88763-075-1 | page = 422}}</ref><ref name="SchindlerCampagnoli2003">{{cite journal | vauthors = Schindler AE, Campagnoli C, Druckmann R, Huber J, Pasqualini JR, Schweppe KW, Thijssen JH | title = Classification and pharmacology of progestins | journal = Maturitas | volume = 46 | pages = S7–S16 | date = December 2003 | issue = Suppl 1 | pmid = 14670641 | doi = 10.1016/j.maturitas.2003.09.014 }}</ref> Turunan diasililasi, etynodiol diacetate, digunakan sebagai kontrasepsi hormonal.<ref name="Macdonald1997" /><ref name="IndexNominum2000" /> Etynodiol terkadang digunakan sebagai sinonim untuk etynodiol diacetate. Obat ini dipatenkan pada tahun 1955.<ref name=Fis2006>{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=478 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA478 |language=en}}</ref>