Kaspofungin: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
Tidak ada ringkasan suntingan Tag: Suntingan perangkat seluler Suntingan peramban seluler Suntingan seluler lanjutan |
||
Baris 16:
| pregnancy_AU_comment =
| pregnancy_category =
| routes_of_administration = [[
| class =
| ATC_prefix = J02
Baris 44:
<!-- Pharmacokinetic data -->
| bioavailability = 100% (
| protein_bound = ~97%
| metabolism = [[
| metabolites =
| onset =
| elimination_half-life = 9–11
| duration_of_action =
| excretion = [[
<!-- Identifiers -->
Baris 80:
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = (4''R'',5''S'')-5-[(2-
1-[(4''R'',5''S'')-5-[(2-
<!-- Chemical and physical data -->
| IUPAC_name = (10''R'',12''S'')-''N''-{(2''R'',6''S'',9''S'',11''R'',12''S'',14a''S'',15''S'',20''S'',23''S'',25a''S'')-12-[(2-
| C=52 | H=88 | N=10 | O=15
| SMILES = [C@@]12(N(C[C@@H](C1)O)C([C@H]([C@@H](C)O)NC(=O)[C@](C[C@H]([C@@H](NCCN)NC([C@@H]3[C@H](CCN3C([C@H]([C@@H](CCN)O)NC(=O)[C@H]([C@@H]([C@H](C4=CC=C(C=C4)O)O)O)NC2=O)=O)O)=O)O)(NC(CCCCCCCC[C@H](C[C@H](CC)C)C)=O)[H])=O)[H]
Baris 106:
}}
'''Kaspofungin''' ([[Nama Generik Internasional|INN]])<ref name="INN"/><ref>[http://www.emea.europa.eu/htms/human/epar/c.htm European Medicines Agency's list of authorised medicines for human use (C)] {{webarchive |url=https://web.archive.org/web/20071017030749/http://www.emea.europa.eu/htms/human/epar/c.htm |date=17 October 2007 }}</ref> adalah obat [[antijamur]] [[lipopeptida]] yang dikembangkan oleh [[Merck & Co.]], Inc..<ref name="Fungicides, antiprotozoa agents, microbiocides">{{cite web |title=Patent Covering Caspofungin |url=https://patents.google.com/patent/US5378804?oq=5378804 | access-date=18 March 2015}}</ref>
kaspofungin adalah penghambat pertama sintesis (1→3)-β-D-glukan jamur yang disetujui oleh [[Badan Pengawas Obat dan Makanan Amerika Serikat]].<ref name="Deresinski SC 2003 1445–1457">{{cite journal | vauthors = Deresinski SC, Stevens DA | title = Caspofungin | journal = Clinical Infectious Diseases | volume = 36 | issue = 11 | pages = 1445–57 | date = June 2003 | pmid = 12766841 | doi = 10.1086/375080 | doi-access = free }}</ref> Kaspofungin diberikan secara [[infus|intravena]].<ref name="Cancidas FDA label" /> Obat ini tercantum dalam [[Daftar Obat Esensial Organisasi Kesehatan Dunia]].<ref name="WHO23rd">{{cite book | vauthors = ((World Health Organization)) | title = The selection and use of essential medicines 2023: web annex A: World Health Organization model list of essential medicines: 23rd list (2023) | year = 2023 | hdl = 10665/371090 | author-link = World Health Organization | publisher = World Health Organization | location = Geneva | id = WHO/MHP/HPS/EML/2023.02 | hdl-access=free }}</ref>
| |||